(4Z,7Z,10Z,13Z,16Z,19Z)-N-(Phenylsulfonyl)docosa-4,7,10,13,16,19-hexaenamide

ID: ALA4552427

PubChem CID: 155554713

Max Phase: Preclinical

Molecular Formula: C28H37NO3S

Molecular Weight: 467.68

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NS(=O)(=O)c1ccccc1

Standard InChI:  InChI=1S/C28H37NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-26-28(30)29-33(31,32)27-24-21-20-22-25-27/h3-4,6-7,9-10,12-13,15-16,18-22,24-25H,2,5,8,11,14,17,23,26H2,1H3,(H,29,30)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-

Standard InChI Key:  KKKAJOUCVKHYEF-KUBAVDMBSA-N

Molfile:  

 
     RDKit          2D

 33 33  0  0  0  0  0  0  0  0999 V2000
    5.2086   -3.7145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8041   -3.0087    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.3951   -3.7119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2280   -3.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9398   -2.6043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6475   -3.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3594   -2.6043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5162   -2.6043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2280   -3.8383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0678   -3.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0693   -3.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7778   -4.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7793   -5.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0723   -5.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0738   -6.2803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3669   -6.6902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6584   -6.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9515   -6.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2430   -6.2855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2415   -5.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5330   -5.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8261   -5.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8276   -6.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1206   -6.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1190   -7.5116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8259   -7.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5344   -7.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1007   -2.6017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1067   -1.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4042   -1.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6990   -1.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7008   -2.6050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4039   -3.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  4  8  1  0
  4  9  2  0
  7 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
  8  2  1  0
  2 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4552427

    ---

Associated Targets(non-human)

RBL-2H3 (1162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.68Molecular Weight (Monoisotopic): 467.2494AlogP: 6.97#Rotatable Bonds: 16
Polar Surface Area: 63.24Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.24CX Basic pKa: CX LogP: 7.54CX LogD: 6.60
Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.27Np Likeness Score: 0.14

References

1. Kim IH, Kanayama Y, Nishiwaki H, Sugahara T, Nishi K..  (2019)  Structure-Activity Relationships of Fish Oil Derivatives with Antiallergic Activity in Vitro and in Vivo.,  62  (21): [PMID:31618024] [10.1021/acs.jmedchem.9b00994]

Source