The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((1H-indazol-4-yl)methyl)-8-isopropyl-2-(piperidin-3-yloxy)pyrazolo[1,5-a][1,3,5]triazin-4-amine ID: ALA4552441
PubChem CID: 78162193
Max Phase: Preclinical
Molecular Formula: C21H26N8O
Molecular Weight: 406.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1cnn2c(NCc3cccc4[nH]ncc34)nc(OC3CCCNC3)nc12
Standard InChI: InChI=1S/C21H26N8O/c1-13(2)16-12-25-29-19(16)26-21(30-15-6-4-8-22-10-15)27-20(29)23-9-14-5-3-7-18-17(14)11-24-28-18/h3,5,7,11-13,15,22H,4,6,8-10H2,1-2H3,(H,24,28)(H,23,26,27)
Standard InChI Key: YUPKNRGPZOEEQC-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
6.4281 -25.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1355 -25.4762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1425 -23.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4254 -24.2392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8530 -24.2473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8466 -25.0684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6256 -25.3311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1111 -24.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6360 -24.0011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1477 -23.0132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4385 -22.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4436 -21.7747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1578 -21.3751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1633 -20.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4535 -20.1366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6177 -26.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9018 -26.5518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3254 -26.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7153 -25.4695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7133 -26.2909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9984 -26.6951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9946 -27.5129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7036 -27.9311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4182 -27.5213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4238 -26.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7347 -21.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7326 -20.5536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9568 -20.3050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4820 -20.9622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9602 -21.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 4 1 0
2 6 1 0
5 3 1 0
3 4 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
3 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 27 1 0
26 12 1 0
7 16 1 0
16 17 1 0
16 18 1 0
1 19 1 0
19 20 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
26 27 2 0
27 28 1 0
28 29 1 0
29 30 2 0
30 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.49Molecular Weight (Monoisotopic): 406.2230AlogP: 2.87#Rotatable Bonds: 6Polar Surface Area: 105.05Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.02CX Basic pKa: 9.26CX LogP: 3.04CX LogD: 1.19Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.45Np Likeness Score: -1.26
References 1. Teng Y, Lu K, Zhang Q, Zhao L, Huang Y, Ingarra AM, Galons H, Li T, Cui S, Yu P, Oumata N.. (2019) Recent advances in the development of cyclin-dependent kinase 7 inhibitors., 183 [PMID:31514062 ] [10.1016/j.ejmech.2019.111641 ]