The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(Di(pyridin-2-yl)methylene)-N-(6-((diethylamino)-methyl)benzo[d]thiazol-2-yl)hydrazine-1-carboxamide ID: ALA4552539
PubChem CID: 141740393
Max Phase: Preclinical
Molecular Formula: C24H25N7OS
Molecular Weight: 459.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)Cc1ccc2nc(NC(=O)NN=C(c3ccccn3)c3ccccn3)sc2c1
Standard InChI: InChI=1S/C24H25N7OS/c1-3-31(4-2)16-17-11-12-18-21(15-17)33-24(27-18)28-23(32)30-29-22(19-9-5-7-13-25-19)20-10-6-8-14-26-20/h5-15H,3-4,16H2,1-2H3,(H2,27,28,30,32)
Standard InChI Key: GQNXNDCMMGWDKD-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
27.4116 -11.6387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4105 -12.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1185 -12.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1167 -11.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8254 -11.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8302 -12.4538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6102 -12.7022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0876 -12.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6024 -11.3777 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.9047 -12.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7038 -11.2303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9962 -11.6391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2884 -11.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9964 -12.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3091 -11.3222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1263 -11.3173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8964 -10.6169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5307 -10.6072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3479 -10.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7523 -9.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5671 -9.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9715 -9.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5586 -8.4746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7373 -8.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3366 -9.1919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7607 -11.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3550 -12.0146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7671 -12.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5851 -12.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9893 -12.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5749 -11.2981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5808 -11.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2888 -12.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
1 11 1 0
11 12 1 0
12 13 1 0
12 14 1 0
10 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
19 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
13 32 1 0
14 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.58Molecular Weight (Monoisotopic): 459.1841AlogP: 4.50#Rotatable Bonds: 8Polar Surface Area: 95.40Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.28CX Basic pKa: 7.42CX LogP: 3.02CX LogD: 2.80Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: -2.07
References 1. Ma J, Ni X, Gao Y, Huang K, Liu J, Wang Y, Chen R, Wang C.. (2019) Identification and biological evaluation of novel benzothiazole derivatives bearing a pyridine-semicarbazone moiety as apoptosis inducers via activation of procaspase-3 to caspase-3., 10 (3): [PMID:31015910 ] [10.1039/C8MD00624E ]