The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Narcissidine ID: ALA4552547
PubChem CID: 443686
Max Phase: Preclinical
Molecular Formula: C18H23NO5
Molecular Weight: 333.38
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)[C@@H]1[C@H](O)[C@@H](OC)[C@H](O)C3=CCN(C2)[C@H]31
Standard InChI: InChI=1S/C18H23NO5/c1-22-12-6-9-8-19-5-4-10-15(19)14(11(9)7-13(12)23-2)17(21)18(24-3)16(10)20/h4,6-7,14-18,20-21H,5,8H2,1-3H3/t14-,15+,16+,17-,18-/m0/s1
Standard InChI Key: OHZXJDOKMFHAFO-PNKHAZJDSA-N
Molfile:
RDKit 2D
26 29 0 0 0 0 0 0 0 0999 V2000
14.2059 -6.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5043 -6.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9117 -7.6808 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9117 -6.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6133 -6.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5084 -7.6849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6216 -5.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1977 -5.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8027 -6.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2100 -8.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9117 -5.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1052 -6.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1052 -7.6849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8068 -8.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6876 -7.9284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1664 -7.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5043 -5.2416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9117 -4.4203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1977 -7.2639 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.9117 -6.0546 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.3967 -8.0922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3989 -6.4608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4018 -5.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6897 -7.6823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2040 -4.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3328 -5.2478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 4 1 0
4 1 1 0
5 4 1 0
6 2 1 0
7 11 1 0
8 1 1 0
9 2 2 0
10 3 1 0
11 8 1 0
12 9 1 0
13 12 2 0
14 6 2 0
15 3 1 0
16 5 2 0
8 17 1 6
11 18 1 1
1 19 1 1
4 20 1 6
5 7 1 0
15 16 1 0
6 10 1 0
14 13 1 0
13 21 1 0
12 22 1 0
22 23 1 0
21 24 1 0
18 25 1 0
7 26 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 333.38Molecular Weight (Monoisotopic): 333.1576AlogP: 0.66#Rotatable Bonds: 3Polar Surface Area: 71.39Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.27CX Basic pKa: 7.97CX LogP: -0.05CX LogD: -0.72Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.79Np Likeness Score: 1.97