The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-N-(2-chloro-5-{1-[1-(N,N-dimethylglycyl)piperidin-4-yl]-1H-pyrazol-4-yl}phenyl)-1,3-oxazole-4-carboxamide ID: ALA4552597
PubChem CID: 135186876
Max Phase: Preclinical
Molecular Formula: C22H26ClN7O3
Molecular Weight: 471.95
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CC(=O)N1CCC(n2cc(-c3ccc(Cl)c(NC(=O)c4coc(N)n4)c3)cn2)CC1
Standard InChI: InChI=1S/C22H26ClN7O3/c1-28(2)12-20(31)29-7-5-16(6-8-29)30-11-15(10-25-30)14-3-4-17(23)18(9-14)26-21(32)19-13-33-22(24)27-19/h3-4,9-11,13,16H,5-8,12H2,1-2H3,(H2,24,27)(H,26,32)
Standard InChI Key: LCXGOCLJMHCEKC-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
6.3145 -9.2493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7827 -8.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5956 -7.4085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6392 -7.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4409 -9.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6471 -7.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6785 -6.2232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6595 -7.9597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6580 -7.3515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6489 -6.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6474 -5.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6598 -6.1756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6689 -7.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6704 -7.9336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6813 -7.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7287 -7.4491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5073 -8.3117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9088 -9.2867 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7866 -9.0647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3835 -10.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5478 -10.4860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0061 -11.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3001 -12.4662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1358 -12.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6775 -11.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7748 -13.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0688 -14.4839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5271 -15.5313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8585 -16.4478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6914 -15.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9391 -13.6655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6365 -5.6196 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.6142 -8.0478 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
4 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
13 15 1 0
16 15 1 0
17 16 2 0
18 17 1 0
18 19 1 0
15 19 2 0
18 20 1 0
21 20 1 0
22 21 1 0
23 22 1 0
23 24 1 0
25 24 1 0
20 25 1 0
23 26 1 0
26 27 1 0
28 27 1 0
28 29 1 0
28 30 1 0
26 31 2 0
10 32 1 0
2 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.95Molecular Weight (Monoisotopic): 471.1786AlogP: 2.75#Rotatable Bonds: 6Polar Surface Area: 122.52Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.93CX Basic pKa: 7.50CX LogP: 1.07CX LogD: 0.72Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.57Np Likeness Score: -1.84
References 1. (2018) Oxazole derivatives for use in the treatment of cancer,