The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
17-Cyclopropylmethyl-3,14beta-dihydroxy-4,5alpha-epoxy-6alpha-(benzothiophene-6-carboxamido)morphinan hydrochloride ID: ALA4552608
PubChem CID: 155556076
Max Phase: Preclinical
Molecular Formula: C29H31ClN2O4S
Molecular Weight: 502.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.O=C(N[C@H]1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5)c1ccc2ccsc2c1
Standard InChI: InChI=1S/C29H30N2O4S.ClH/c32-21-6-5-18-14-23-29(34)9-7-20(30-27(33)19-4-3-17-8-12-36-22(17)13-19)26-28(29,24(18)25(21)35-26)10-11-31(23)15-16-1-2-16;/h3-6,8,12-13,16,20,23,26,32,34H,1-2,7,9-11,14-15H2,(H,30,33);1H/t20-,23+,26-,28-,29+;/m0./s1
Standard InChI Key: DZWYNQBCTMNHRG-HBJKKLOVSA-N
Molfile:
RDKit 2D
39 45 0 0 0 0 0 0 0 0999 V2000
17.2071 -15.0562 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.7586 -11.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1693 -11.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7305 -10.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7586 -9.6313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1693 -8.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9950 -8.8954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7168 -9.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7089 -8.4707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3338 -10.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3338 -11.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9329 -10.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5319 -11.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9329 -11.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5319 -12.5808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3057 -13.0795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1553 -12.5808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9810 -12.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4057 -11.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9950 -11.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3959 -13.3228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2174 -13.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6240 -14.0456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4498 -14.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8537 -14.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4384 -15.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6144 -15.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2063 -14.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3586 -16.2554 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.0190 -16.7397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6842 -16.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6325 -12.6160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1553 -13.5062 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.7063 -12.5808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2895 -11.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7063 -11.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2815 -13.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4565 -10.0462 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.5800 -10.4430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 3 1 0
4 5 1 0
6 5 1 0
7 6 1 0
8 7 1 0
9 8 1 0
9 7 1 0
5 10 1 0
10 11 1 0
2 11 1 1
4 12 1 0
12 13 1 0
13 14 1 0
14 2 1 0
15 14 2 0
16 15 1 0
16 17 1 0
17 2 1 0
18 17 1 0
19 18 1 0
20 19 1 0
20 3 1 0
18 21 1 6
21 22 1 0
22 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
27 29 1 0
30 29 1 0
31 30 2 0
26 31 1 0
22 32 2 0
17 33 1 1
34 15 1 0
34 35 2 0
35 36 1 0
36 13 2 0
37 34 1 0
4 38 1 6
3 39 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.64Molecular Weight (Monoisotopic): 502.1926AlogP: 3.97#Rotatable Bonds: 4Polar Surface Area: 82.03Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.29CX Basic pKa: 9.51CX LogP: 3.25CX LogD: 1.42Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.50Np Likeness Score: 0.46
References 1. Ma H, Obeng S, Wang H, Zheng Y, Li M, Jali AM, Stevens DL, Dewey WL, Selley DE, Zhang Y.. (2019) Application of Bivalent Bioisostere Concept on Design and Discovery of Potent Opioid Receptor Modulators., 62 (24): [PMID:31782922 ] [10.1021/acs.jmedchem.9b01767 ]