NA

ID: ALA4552658

PubChem CID: 11266813

Max Phase: Preclinical

Molecular Formula: C19H16O4

Molecular Weight: 308.33

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CCC12OCC3CC(C=C4C(=O)c5ccccc5OC431)C2=O

Standard InChI:  InChI=1S/C19H16O4/c1-2-7-18-17(21)11-8-12(10-22-18)19(18)14(9-11)16(20)13-5-3-4-6-15(13)23-19/h2-6,9,11-12H,1,7-8,10H2

Standard InChI Key:  XXEGDAJKQJAIGL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 27  0  0  0  0  0  0  0  0999 V2000
    0.6507  -18.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6495  -19.1361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3576  -19.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3558  -17.9077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0644  -18.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0678  -19.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7802  -19.5456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7734  -17.8952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4904  -18.3072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4914  -19.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2040  -19.5442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9202  -19.1322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9191  -18.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2019  -17.8905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8961  -18.5973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6060  -18.7748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7009  -20.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8536  -17.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1055  -16.6684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5742  -17.7595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9806  -17.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5699  -16.3441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7689  -17.0780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5  8  1  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  1  0
  9 14  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 10 15  1  0
 15 16  1  0
 16 17  1  0
 11 17  1  0
 15 18  1  0
 13 18  1  0
 18 19  2  0
 15 20  1  0
 20 21  1  0
 21 22  2  0
  8 23  2  0
M  END

Associated Targets(Human)

HSP90AA1 Tchem Heat shock protein HSP 90-alpha (4115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 308.33Molecular Weight (Monoisotopic): 308.1049AlogP: 2.49#Rotatable Bonds: 2
Polar Surface Area: 52.60Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 14.00CX Basic pKa: CX LogP: 2.55CX LogD: 2.55
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.79Np Likeness Score: 2.18

References

1. Xu X, Wu Y, Hu M, Li X, Gu C, You Q, Zhang X..  (2016)  Structure-activity relationship of Garcinia xanthones analogues: Potent Hsp90 inhibitors with cytotoxicity and antiangiogenesis activity.,  24  (19): [PMID:27527413] [10.1016/j.bmc.2016.07.067]

Source