(2S)-methyl 2-(benzyloxycarbonylamino)-4-(heptylsulfinyl)butanoate

ID: ALA4552756

PubChem CID: 155556424

Max Phase: Preclinical

Molecular Formula: C20H31NO5S

Molecular Weight: 397.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCC[S+]([O-])CC[C@H](NC(=O)OCc1ccccc1)C(=O)OC

Standard InChI:  InChI=1S/C20H31NO5S/c1-3-4-5-6-10-14-27(24)15-13-18(19(22)25-2)21-20(23)26-16-17-11-8-7-9-12-17/h7-9,11-12,18H,3-6,10,13-16H2,1-2H3,(H,21,23)/t18-,27?/m0/s1

Standard InChI Key:  YWFDMSGYYKKJOU-HSYKDVHTSA-N

Molfile:  

 
     RDKit          2D

 27 27  0  0  0  0  0  0  0  0999 V2000
   12.0144  -16.5873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7221  -16.1787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4298  -16.5873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7221  -15.3615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3067  -16.1787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5989  -16.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1375  -16.1787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8452  -16.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5529  -16.1787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8452  -17.4045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2606  -16.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1375  -15.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8452  -14.9529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8452  -14.1358    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.5529  -13.7272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5529  -12.9100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2606  -12.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2606  -11.6842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9683  -11.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6760  -11.6842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3837  -11.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1375  -13.7272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8918  -16.1756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1846  -16.5835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1841  -17.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8968  -17.8100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6011  -17.3998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  5  6  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
  7 12  1  1
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 14 22  1  0
  6 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27  6  1  0
M  CHG  2  14   1  22  -1
M  END

Alternative Forms

  1. Parent:

    ALA4552756

    ---

Associated Targets(non-human)

Mboat4 Ghrelin O-acyltransferase (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.54Molecular Weight (Monoisotopic): 397.1923AlogP: 3.56#Rotatable Bonds: 13
Polar Surface Area: 87.69Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.19CX Basic pKa: CX LogP: 2.82CX LogD: 2.82
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.31Np Likeness Score: -0.11

References

1.  (2012)  Small molecule inhibitors of ghrelin O-acyltransferase, 

Source