The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-methyl 2-(benzyloxycarbonylamino)-4-(heptylsulfinyl)butanoate ID: ALA4552756
PubChem CID: 155556424
Max Phase: Preclinical
Molecular Formula: C20H31NO5S
Molecular Weight: 397.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCC[S+]([O-])CC[C@H](NC(=O)OCc1ccccc1)C(=O)OC
Standard InChI: InChI=1S/C20H31NO5S/c1-3-4-5-6-10-14-27(24)15-13-18(19(22)25-2)21-20(23)26-16-17-11-8-7-9-12-17/h7-9,11-12,18H,3-6,10,13-16H2,1-2H3,(H,21,23)/t18-,27?/m0/s1
Standard InChI Key: YWFDMSGYYKKJOU-HSYKDVHTSA-N
Molfile:
RDKit 2D
27 27 0 0 0 0 0 0 0 0999 V2000
12.0144 -16.5873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7221 -16.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4298 -16.5873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7221 -15.3615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3067 -16.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5989 -16.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1375 -16.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8452 -16.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5529 -16.1787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8452 -17.4045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2606 -16.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1375 -15.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8452 -14.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8452 -14.1358 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.5529 -13.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5529 -12.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2606 -12.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2606 -11.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9683 -11.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6760 -11.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3837 -11.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1375 -13.7272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8918 -16.1756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1846 -16.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1841 -17.4016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8968 -17.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6011 -17.3998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
5 6 1 0
3 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
7 12 1 1
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
14 22 1 0
6 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 6 1 0
M CHG 2 14 1 22 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 397.54Molecular Weight (Monoisotopic): 397.1923AlogP: 3.56#Rotatable Bonds: 13Polar Surface Area: 87.69Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.19CX Basic pKa: ┄CX LogP: 2.82CX LogD: 2.82Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.31Np Likeness Score: -0.11
References 1. (2012) Small molecule inhibitors of ghrelin O-acyltransferase,