N-[(1R,6R)-6-Amino-2,2-difluorocyclohexyl]-4-(imidazo[1,2-b]pyridazin-3-yl)-5-methylthiophene-2-carboxamide

ID: ALA4552799

PubChem CID: 155555954

Max Phase: Preclinical

Molecular Formula: C18H19F2N5OS

Molecular Weight: 391.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1sc(C(=O)N[C@@H]2[C@H](N)CCCC2(F)F)cc1-c1cnn2cccnc12

Standard InChI:  InChI=1S/C18H19F2N5OS/c1-10-11(12-9-23-25-7-3-6-22-16(12)25)8-14(27-10)17(26)24-15-13(21)4-2-5-18(15,19)20/h3,6-9,13,15H,2,4-5,21H2,1H3,(H,24,26)/t13-,15-/m1/s1

Standard InChI Key:  PMMXJDXPWVTHQK-UKRRQHHQSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   30.7767  -11.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7767  -12.5138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4820  -12.9182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4820  -11.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1873  -11.6966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1873  -12.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9654  -12.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4464  -12.1057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9655  -11.4438    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2195  -13.5490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7392  -14.2101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2195  -14.8713    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   33.9967  -14.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9967  -13.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6579  -15.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5724  -15.9119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4044  -14.7668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.0655  -15.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9220  -14.2101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9762  -16.0591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6333  -16.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3819  -16.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4693  -15.3968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8083  -14.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8935  -14.0993    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1805  -16.2695    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.7583  -16.8473    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
  7 10  1  0
 13 15  1  0
 15 16  2  0
 15 17  1  0
 18 17  1  6
 11 19  1  0
 18 20  1  0
 18 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  6
 20 26  1  0
 20 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4552799

    ---

Associated Targets(Human)

MARK3 Tchem Serine/threonine-protein kinase c-TAK1 (2532 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 391.45Molecular Weight (Monoisotopic): 391.1278AlogP: 3.01#Rotatable Bonds: 3
Polar Surface Area: 85.31Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.28CX LogP: 2.58CX LogD: 0.72
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.72Np Likeness Score: -1.26

References

1. Sloman DL, Noucti N, Altman MD, Chen D, Mislak AC, Szewczak A, Hayashi M, Warren L, Dellovade T, Wu Z, Marcus J, Walker D, Su HP, Edavettal SC, Munshi S, Hutton M, Nuthall H, Stanton MG..  (2016)  Optimization of microtubule affinity regulating kinase (MARK) inhibitors with improved physical properties.,  26  (17): [PMID:27491711] [10.1016/j.bmcl.2016.02.003]

Source