(6aS,6bR,8aS,11S,12bS,14aR)-2-hydroxy-3-methoxy-6b,8a,11,12b,14a-pentamethyl-11-(methylperoxymethyl)-6,6a,7,8,8a,9,10,11,12,12a,12b,13,14,14a-tetradecahydropicen-5(6bH)-one

ID: ALA4552843

PubChem CID: 155556262

Max Phase: Preclinical

Molecular Formula: C30H44O5

Molecular Weight: 484.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COOC[C@@]1(C)CC[C@]2(C)CC[C@]3(C)[C@@H]4CC(=O)c5cc(OC)c(O)cc5[C@]4(C)CC[C@@]3(C)C2C1

Standard InChI:  InChI=1S/C30H44O5/c1-26(18-35-34-7)8-9-27(2)10-12-29(4)24-16-21(31)19-14-23(33-6)22(32)15-20(19)28(24,3)11-13-30(29,5)25(27)17-26/h14-15,24-25,32H,8-13,16-18H2,1-7H3/t24-,25?,26+,27-,28+,29-,30+/m1/s1

Standard InChI Key:  NUKMCKWOSDIKPK-OEGJDTTLSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   17.1858   -1.3744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5985   -2.0843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0069   -1.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7178   -6.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4279   -5.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7248   -4.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4314   -4.9263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4482   -3.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7301   -3.6886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4235   -4.1066    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.7132   -6.9592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1539   -3.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1415   -4.5241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8396   -4.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5545   -4.5454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7177   -5.3241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0158   -5.7327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0208   -4.9173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3184   -4.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6103   -4.9110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6092   -5.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3123   -6.1361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9011   -6.1374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1333   -5.3406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1457   -2.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8644   -3.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5692   -3.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2858   -3.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3038   -2.5129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8761   -2.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9040   -4.5001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1938   -5.7280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5614   -2.9097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8241   -1.3694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2306   -0.6605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0477   -0.6580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  1
 18  6  1  0
 17  4  1  0
  4  5  1  0
  5  7  1  0
  6  7  1  0
  6  9  1  0
  7 13  1  0
 12  8  1  0
  8  9  1  0
  7 10  1  1
  4 11  2  0
 12 13  1  0
 12 26  1  0
 13 14  1  0
 14 15  1  0
 15 27  1  0
  6 16  1  1
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 21 23  1  0
 13 24  1  1
 12 25  1  6
 26 27  1  0
 26 30  1  0
 27 28  1  0
 28 29  1  0
 29  2  1  0
  2 30  1  0
 20 31  1  0
 23 32  1  0
 27 33  1  1
  3 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4552843

    ---

Associated Targets(Human)

PTGS2 Tclin Cyclooxygenase-2 (13999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.68Molecular Weight (Monoisotopic): 484.3189AlogP: 6.85#Rotatable Bonds: 4
Polar Surface Area: 64.99Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.19CX Basic pKa: CX LogP: 6.15CX LogD: 6.09
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.37Np Likeness Score: 2.37

References

1. Kishore N, Kumar P, Shanker K, Verma AK..  (2019)  Human disorders associated with inflammation and the evolving role of natural products to overcome.,  179  [PMID:31255927] [10.1016/j.ejmech.2019.06.034]

Source