The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-Methoxy-5-(4-((1-(tetrahydro-2H-pyran-4-carbonyl)piperidin-4-yl)amino)quinazolin-6-yl)pyridin-3-yl)methanesulfonamide ID: ALA4552869
PubChem CID: 155556396
Max Phase: Preclinical
Molecular Formula: C26H32N6O5S
Molecular Weight: 540.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ncc(-c2ccc3ncnc(NC4CCN(C(=O)C5CCOCC5)CC4)c3c2)cc1NS(C)(=O)=O
Standard InChI: InChI=1S/C26H32N6O5S/c1-36-25-23(31-38(2,34)35)14-19(15-27-25)18-3-4-22-21(13-18)24(29-16-28-22)30-20-5-9-32(10-6-20)26(33)17-7-11-37-12-8-17/h3-4,13-17,20,31H,5-12H2,1-2H3,(H,28,29,30)
Standard InChI Key: MGDVTCQNJBFWSE-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
6.7274 -3.1119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9061 -3.1119 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.3147 -3.8238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6145 -5.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6134 -6.8122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3256 -7.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3238 -5.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0365 -5.9850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0373 -6.8081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7458 -7.2193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4582 -6.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4535 -5.9781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7402 -5.5747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9047 -5.5803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9058 -4.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1947 -4.3454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4820 -4.7584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4848 -5.5839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1965 -5.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7695 -4.3467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0583 -4.7606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1949 -3.5241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9070 -2.2944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7359 -4.7534 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4456 -4.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1549 -4.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8624 -4.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8623 -3.5139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1485 -3.1069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4347 -3.5175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5735 -3.1043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2860 -3.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5723 -2.2830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2816 -4.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9900 -4.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7036 -4.3358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7043 -3.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9914 -3.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
4 14 1 0
17 20 1 0
20 21 1 0
16 22 1 0
22 2 1 0
2 23 1 0
13 24 1 0
25 24 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
28 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
32 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.65Molecular Weight (Monoisotopic): 540.2155AlogP: 2.90#Rotatable Bonds: 7Polar Surface Area: 135.64Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.78CX Basic pKa: 4.76CX LogP: 0.41CX LogD: 0.27Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.46Np Likeness Score: -1.41
References 1. Hei YY, Zhang SQ, Feng Y, Wang J, Duan W, Zhang H, Mao S, Sun H, Xin M.. (2019) Alkylsulfonamide-containing quinazoline derivatives as potent and orally bioavailable PI3Ks inhibitors., 27 (20): [PMID:31176568 ] [10.1016/j.bmc.2019.05.043 ]