The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(tert-Butyl)-1-(4-fluorophenyl)-1H-pyrazol-5-yl)-3-(4-(8-(cyclopropylamino)imidazo[1,2-a]pyrazin-5-yl)-3-methylphenyl)urea ID: ALA4552889
PubChem CID: 142727679
Max Phase: Preclinical
Molecular Formula: C30H31FN8O
Molecular Weight: 538.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(NC(=O)Nc2cc(C(C)(C)C)nn2-c2ccc(F)cc2)ccc1-c1cnc(NC2CC2)c2nccn12
Standard InChI: InChI=1S/C30H31FN8O/c1-18-15-21(9-12-23(18)24-17-33-27(34-20-7-8-20)28-32-13-14-38(24)28)35-29(40)36-26-16-25(30(2,3)4)37-39(26)22-10-5-19(31)6-11-22/h5-6,9-17,20H,7-8H2,1-4H3,(H,33,34)(H2,35,36,40)
Standard InChI Key: NKXGUPHVNODLSQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
30.7396 -26.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4449 -26.4886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1543 -26.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1543 -25.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7373 -25.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4449 -24.8459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2747 -24.0425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4578 -23.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1258 -24.7081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8637 -24.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5746 -25.2707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2871 -24.8607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2900 -24.0385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5744 -23.6280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8647 -24.0362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0289 -26.4947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0313 -27.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0025 -23.6311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7136 -24.0408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4261 -23.6333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7123 -24.8621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1332 -24.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2235 -24.8592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0267 -25.0304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.4365 -24.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8864 -23.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8066 -25.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9847 -25.5604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5720 -26.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9761 -26.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8012 -26.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2143 -26.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6233 -28.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4446 -28.0263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1530 -23.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2541 -24.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6681 -25.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6655 -23.6092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0754 -24.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5641 -27.6934 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
4 10 1 0
1 16 1 0
16 17 1 0
13 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 22 2 0
23 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
33 17 1 0
34 33 1 0
17 34 1 0
15 35 1 0
25 36 1 0
36 37 1 0
36 38 1 0
36 39 1 0
30 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.63Molecular Weight (Monoisotopic): 538.2605AlogP: 6.55#Rotatable Bonds: 6Polar Surface Area: 101.17Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.32CX Basic pKa: 3.60CX LogP: 5.55CX LogD: 5.55Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.23Np Likeness Score: -1.93
References 1. Kang SJ, Lee JW, Chung SH, Jang SY, Choi J, Suh KH, Kim YH, Ham YJ, Min KH.. (2019) Synthesis and anti-tumor activity of imidazopyrazines as TAK1 inhibitors., 163 [PMID:30576901 ] [10.1016/j.ejmech.2018.12.025 ]