The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-(2-oxo-2-phenylethyl)-2-thioxo-5-(3,4,5-trimethoxybenzylidene)thiazolidin-4-one ID: ALA4552935
PubChem CID: 155556087
Max Phase: Preclinical
Molecular Formula: C21H19NO5S2
Molecular Weight: 429.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C2/SC(=S)N(CC(=O)c3ccccc3)C2=O)cc(OC)c1OC
Standard InChI: InChI=1S/C21H19NO5S2/c1-25-16-9-13(10-17(26-2)19(16)27-3)11-18-20(24)22(21(28)29-18)12-15(23)14-7-5-4-6-8-14/h4-11H,12H2,1-3H3/b18-11+
Standard InChI Key: IBBHJVAXOWNKEK-WOJGMQOQSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
43.0346 -18.5189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8559 -18.5189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.1103 -17.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4432 -17.2559 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.7844 -17.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5617 -18.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5587 -19.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2690 -20.1682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8453 -20.1630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.5493 -19.1835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.8919 -17.4866 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.0688 -17.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2617 -20.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9670 -21.3991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6814 -20.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6818 -20.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9717 -19.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3565 -17.7379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6493 -17.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9374 -17.7327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9359 -18.5549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6522 -18.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3612 -18.5549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2263 -17.3188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2241 -18.9636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6541 -19.7856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2277 -16.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5122 -18.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9432 -20.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
2 6 1 0
6 7 1 0
7 8 1 0
7 9 2 0
1 10 2 0
3 11 2 0
5 12 2 0
8 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 8 1 0
12 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
20 24 1 0
21 25 1 0
22 26 1 0
24 27 1 0
25 28 1 0
26 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.52Molecular Weight (Monoisotopic): 429.0705AlogP: 3.80#Rotatable Bonds: 7Polar Surface Area: 65.07Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.76CX Basic pKa: ┄CX LogP: 3.72CX LogD: 3.72Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.38Np Likeness Score: -1.13
References 1. Xu JF, Wang TT, Yuan Q, Duan YT, Xu YJ, Lv PC, Wang XM, Yang YS, Zhu HL.. (2019) Discovery and development of novel rhodanine derivatives targeting enoyl-acyl carrier protein reductase., 27 (8): [PMID:30846404 ] [10.1016/j.bmc.2019.02.043 ]