The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Mallotophilippen F ID: ALA4552940
PubChem CID: 155556128
Max Phase: Preclinical
Molecular Formula: C30H34O4
Molecular Weight: 458.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)=CCC/C(C)=C/Cc1c(O)c2c(c(C(=O)/C=C/c3ccccc3)c1O)OC(C)(C)C=C2
Standard InChI: InChI=1S/C30H34O4/c1-20(2)10-9-11-21(3)14-16-23-27(32)24-18-19-30(4,5)34-29(24)26(28(23)33)25(31)17-15-22-12-7-6-8-13-22/h6-8,10,12-15,17-19,32-33H,9,11,16H2,1-5H3/b17-15+,21-14+
Standard InChI Key: AIIWLAINTCRNRT-MSBFWHRESA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
21.2181 -23.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0076 -24.6272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7991 -24.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8972 -25.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8960 -26.6766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6041 -27.0856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3137 -26.6761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6023 -25.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3100 -25.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0114 -25.4462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3034 -24.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5959 -24.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1894 -25.4486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6039 -27.9027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0223 -27.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0240 -27.9004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7291 -26.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4377 -27.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1446 -26.6701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8532 -27.0793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5595 -26.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5582 -25.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8447 -25.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1413 -25.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1880 -27.0846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4806 -26.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7726 -27.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0652 -26.6743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7719 -27.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3572 -27.0824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6498 -26.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9417 -27.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2344 -26.6721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9411 -27.8985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 4 1 0
8 9 2 0
8 12 1 0
9 10 1 0
10 2 1 0
2 11 1 0
11 12 2 0
4 13 1 0
6 14 1 0
7 15 1 0
15 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
5 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
27 29 1 0
28 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
32 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.60Molecular Weight (Monoisotopic): 458.2457AlogP: 7.41#Rotatable Bonds: 8Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.17CX Basic pKa: ┄CX LogP: 8.22CX LogD: 7.77Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: 2.36
References 1. Cheenpracha S, Pyne SG, Patrick BO, Andersen RJ, Maneerat W, Laphookhieo S.. (2019) Mallopenins A-E, Antibacterial Phenolic Derivatives from the Fruits of Mallotus philippensis ., 82 (8): [PMID:31318550 ] [10.1021/acs.jnatprod.9b00182 ]