Penicilone D

ID: ALA4552969

PubChem CID: 155556264

Max Phase: Preclinical

Molecular Formula: C29H33ClO6

Molecular Weight: 513.03

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCC[C@H](C)/C=C(\C)C(=O)O[C@@]1(C)C(=O)C2=COC(c3c(C)cccc3O)=CC2=C(Cl)C1=O

Standard InChI:  InChI=1S/C29H33ClO6/c1-6-7-8-9-11-17(2)14-19(4)28(34)36-29(5)26(32)21-16-35-23(15-20(21)25(30)27(29)33)24-18(3)12-10-13-22(24)31/h10,12-17,31H,6-9,11H2,1-5H3/b19-14+/t17-,29-/m0/s1

Standard InChI Key:  VBEXROICVMHLSP-ZIPCLRBCSA-N

Molfile:  

 
     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   10.1984   -8.9396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1984   -9.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9078  -10.1654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9078   -8.5227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6172   -8.9396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6137   -9.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3199  -10.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0341   -9.7669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0375   -8.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3269   -8.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7478   -8.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4573   -8.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1692   -8.5546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1777   -7.7330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4682   -7.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7502   -7.7215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0450   -7.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4511   -9.7815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4854   -8.5289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4871  -10.1705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9087  -10.9867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7747   -9.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0635  -10.1726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7735   -8.9416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3552   -9.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6439  -10.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0647  -10.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9315   -9.7671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6451  -10.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2203  -10.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5078   -9.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7966  -10.1787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0842   -9.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3770  -10.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1943  -10.5822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9078   -7.7014    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  2  0
  5  6  1  0
  5 10  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 11 12  1  0
 11 16  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
  9 11  1  0
 16 17  1  0
 12 18  1  0
  1 19  2  0
  2 20  1  0
  3 21  2  0
 20 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  2  0
 25 26  1  0
 23 27  1  0
 26 28  1  0
 26 29  1  1
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
  2 35  1  1
  4 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4552969

    ---

Associated Targets(Human)

SMMC-7721 (5516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.03Molecular Weight (Monoisotopic): 512.1966AlogP: 6.46#Rotatable Bonds: 9
Polar Surface Area: 89.90Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.06CX Basic pKa: CX LogP: 7.50CX LogD: 7.41
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.18Np Likeness Score: 1.87

References

1. Chen M, Zheng YY, Chen ZQ, Shen NX, Shen L, Zhang FM, Zhou XJ, Wang CY..  (2019)  NaBr-Induced Production of Brominated Azaphilones and Related Tricyclic Polyketides by the Marine-Derived Fungus Penicillium janthinellum HK1-6.,  82  (2): [PMID:30693772] [10.1021/acs.jnatprod.8b00930]

Source