N-(2-Bromo-4-methylphenyl)-7-((4-methoxyphenyl)sulfonyl)-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-d]pyrimidin-4-amine

ID: ALA4553042

PubChem CID: 155555925

Max Phase: Preclinical

Molecular Formula: C23H21BrN4O3S2

Molecular Weight: 545.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)N2CCc3c(sc4ncnc(Nc5ccc(C)cc5Br)c34)C2)cc1

Standard InChI:  InChI=1S/C23H21BrN4O3S2/c1-14-3-8-19(18(24)11-14)27-22-21-17-9-10-28(12-20(17)32-23(21)26-13-25-22)33(29,30)16-6-4-15(31-2)5-7-16/h3-8,11,13H,9-10,12H2,1-2H3,(H,25,26,27)

Standard InChI Key:  YXIHVMFHIZQRDT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   40.8472  -30.2897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.8513  -29.4725    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   40.1415  -29.8776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.4806  -27.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4795  -28.2614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1875  -28.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.8972  -28.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.8944  -27.4383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1858  -27.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7715  -28.6695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.7708  -29.4867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7696  -31.1196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.4800  -30.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4775  -29.8921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.0617  -30.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0586  -29.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2866  -30.9646    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   42.8044  -30.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2830  -29.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9547  -28.9099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1469  -28.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6686  -29.4791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.9976  -30.2248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4477  -28.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8644  -28.0594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4613  -27.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6433  -27.3434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2300  -28.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6355  -28.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2385  -26.6335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.6510  -25.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.6005  -27.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7728  -27.0335    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
 10 11  1  0
 11 16  2  0
 15 12  2  0
 12 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  1  0
 16 19  1  0
 18 17  1  0
 17 15  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22  2  1  0
  2 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 30 31  1  0
  8 32  1  0
  4 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4553042

    ---

Associated Targets(Human)

SUNE1 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MKNK1 Tchem MAP kinase-interacting serine/threonine-protein kinase MNK1 (2071 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
786-0 (47912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 545.48Molecular Weight (Monoisotopic): 544.0238AlogP: 5.26#Rotatable Bonds: 5
Polar Surface Area: 84.42Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 2.51CX LogP: 5.40CX LogD: 5.40
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -2.13

References

1. Zhang M, Jiang L, Tao J, Pan Z, He M, Su D, He G, Jiang Q..  (2019)  Design, synthesis and biological evaluation of 4-aniline-thieno[2,3-d]pyrimidine derivatives as MNK1 inhibitors against renal cell carcinoma and nasopharyngeal carcinoma.,  27  (11): [PMID:31014565] [10.1016/j.bmc.2019.04.022]

Source