The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2E,2'E)-N,N'-(Disulfanediylbis(ethane-2,1-diyl))bis(2-(methhydroxyimino)-3-(3-chlorophenyl)propanamide) ID: ALA4553091
PubChem CID: 155556271
Max Phase: Preclinical
Molecular Formula: C24H26Cl4N4O4S2
Molecular Weight: 640.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C(\Cc1ccc(Cl)cc1Cl)C(=O)NCCSSCCNC(=O)/C(Cc1ccc(Cl)cc1Cl)=N/OC
Standard InChI: InChI=1S/C24H26Cl4N4O4S2/c1-35-31-21(11-15-3-5-17(25)13-19(15)27)23(33)29-7-9-37-38-10-8-30-24(34)22(32-36-2)12-16-4-6-18(26)14-20(16)28/h3-6,13-14H,7-12H2,1-2H3,(H,29,33)(H,30,34)/b31-21+,32-22+
Standard InChI Key: XSMVMQYYSMFKPY-RWRHWQIFSA-N
Molfile:
RDKit 2D
38 39 0 0 0 0 0 0 0 0999 V2000
5.6584 -11.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4795 -11.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7696 -11.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3683 -11.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6626 -12.5509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4795 -10.4749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8148 -11.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3232 -11.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9403 -11.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1977 -11.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8148 -12.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3149 -10.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5247 -11.3334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6133 -11.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9075 -11.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2345 -11.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3683 -10.4997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7779 -12.5261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0598 -11.2962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0823 -11.7255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5247 -12.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6009 -10.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9260 -11.7172 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.2120 -11.3086 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.8993 -10.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2428 -12.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1894 -10.0581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9527 -12.9636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5021 -11.7172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6359 -11.3045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3499 -11.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7922 -11.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9485 -13.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1853 -9.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5247 -10.5162 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.1064 -12.9708 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.6123 -12.5096 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.0207 -10.0506 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 19 1 0
4 1 1 0
5 1 2 0
6 2 2 0
7 13 1 0
8 14 1 0
9 1 1 0
10 2 1 0
11 21 1 0
12 22 1 0
13 16 2 0
14 15 2 0
15 10 1 0
16 9 1 0
17 4 2 0
18 3 2 0
19 31 1 0
20 4 1 0
21 26 2 0
22 25 2 0
23 24 1 0
24 29 1 0
25 15 1 0
26 16 1 0
27 6 1 0
28 5 1 0
29 32 1 0
30 23 1 0
31 30 1 0
32 20 1 0
11 7 2 0
12 8 2 0
28 33 1 0
27 34 1 0
13 35 1 0
11 36 1 0
14 37 1 0
12 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 640.44Molecular Weight (Monoisotopic): 638.0150AlogP: 5.70#Rotatable Bonds: 15Polar Surface Area: 101.38Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.82CX Basic pKa: ┄CX LogP: 6.32CX LogD: 6.32Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.11Np Likeness Score: -0.42
References 1. Wen J, Bao Y, Niu Q, Liu J, Yang J, Wang W, Jiang T, Fan Y, Li K, Wang J, Zhao L, Liu D.. (2016) Synthesis, biological evaluation and molecular modeling studies of psammaplin A and its analogs as potent histone deacetylases inhibitors and cytotoxic agents., 26 (17): [PMID:27460171 ] [10.1016/j.bmcl.2015.12.094 ]