N-((S)-1-(((S,E)-6-Amino-6-oxo-1-phenylhex-4-en-3-yl)amino)-1-oxo-3-phenylpropan-2-yl)-4-methylpiperazine-1-carboxamide

ID: ALA4553115

PubChem CID: 155556369

Max Phase: Preclinical

Molecular Formula: C27H35N5O3

Molecular Weight: 477.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCN(C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](/C=C/C(N)=O)CCc2ccccc2)CC1

Standard InChI:  InChI=1S/C27H35N5O3/c1-31-16-18-32(19-17-31)27(35)30-24(20-22-10-6-3-7-11-22)26(34)29-23(14-15-25(28)33)13-12-21-8-4-2-5-9-21/h2-11,14-15,23-24H,12-13,16-20H2,1H3,(H2,28,33)(H,29,34)(H,30,35)/b15-14+/t23-,24-/m0/s1

Standard InChI Key:  YCULQFOXMJEQGK-YNBDVOJHSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   11.0197   -7.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6520   -7.7296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3581   -7.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0674   -7.7243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3550   -6.5011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7735   -7.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4828   -7.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1889   -7.3077    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4858   -8.5361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8982   -7.7136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6043   -7.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9013   -8.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6105   -8.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6085   -9.7537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3136   -7.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7290   -7.7029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7704   -6.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4766   -6.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1834   -6.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8891   -6.0842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8865   -5.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1723   -4.8604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4695   -5.2733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0166   -6.4798    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8984  -10.1578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8961  -10.9741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6032  -11.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3141  -10.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3130  -10.1591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9442   -7.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2401   -7.7345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2390   -8.5520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9480   -8.9601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6583   -8.5507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5312   -8.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 10 12  1  6
 12 13  1  0
 13 14  1  0
 11 15  2  0
 15  1  1  0
  1 16  1  0
  6 17  1  1
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  1 24  2  0
 14 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 14  1  0
  2 30  1  0
  2 34  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4553115

    ---

Associated Targets(non-human)

Cruzipain (33337 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.61Molecular Weight (Monoisotopic): 477.2740AlogP: 1.71#Rotatable Bonds: 10
Polar Surface Area: 107.77Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.02CX LogP: 2.14CX LogD: 1.99
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.45Np Likeness Score: -0.36

References

1. Chenna BC, Li L, Mellott DM, Zhai X, Siqueira-Neto JL, Calvet Alvarez C, Bernatchez JA, Desormeaux E, Alvarez Hernandez E, Gomez J, McKerrow JH, Cruz-Reyes J, Meek TD..  (2020)  Peptidomimetic Vinyl Heterocyclic Inhibitors of Cruzain Effect Antitrypanosomal Activity.,  63  (6): [PMID:32125159] [10.1021/acs.jmedchem.9b02078]

Source