The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-(((S,E)-6-Amino-6-oxo-1-phenylhex-4-en-3-yl)amino)-1-oxo-3-phenylpropan-2-yl)-4-methylpiperazine-1-carboxamide ID: ALA4553115
PubChem CID: 155556369
Max Phase: Preclinical
Molecular Formula: C27H35N5O3
Molecular Weight: 477.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](/C=C/C(N)=O)CCc2ccccc2)CC1
Standard InChI: InChI=1S/C27H35N5O3/c1-31-16-18-32(19-17-31)27(35)30-24(20-22-10-6-3-7-11-22)26(34)29-23(14-15-25(28)33)13-12-21-8-4-2-5-9-21/h2-11,14-15,23-24H,12-13,16-20H2,1H3,(H2,28,33)(H,29,34)(H,30,35)/b15-14+/t23-,24-/m0/s1
Standard InChI Key: YCULQFOXMJEQGK-YNBDVOJHSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
11.0197 -7.2969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6520 -7.7296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3581 -7.3183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0674 -7.7243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3550 -6.5011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7735 -7.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4828 -7.7189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1889 -7.3077 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4858 -8.5361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8982 -7.7136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6043 -7.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9013 -8.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6105 -8.9367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6085 -9.7537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3136 -7.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7290 -7.7029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7704 -6.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4766 -6.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1834 -6.4948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8891 -6.0842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8865 -5.2662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1723 -4.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4695 -5.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0166 -6.4798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8984 -10.1578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8961 -10.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6032 -11.3852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3141 -10.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3130 -10.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9442 -7.3267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2401 -7.7345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2390 -8.5520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9480 -8.9601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6583 -8.5507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5312 -8.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
3 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
10 12 1 6
12 13 1 0
13 14 1 0
11 15 2 0
15 1 1 0
1 16 1 0
6 17 1 1
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
1 24 2 0
14 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 14 1 0
2 30 1 0
2 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
32 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.61Molecular Weight (Monoisotopic): 477.2740AlogP: 1.71#Rotatable Bonds: 10Polar Surface Area: 107.77Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.02CX LogP: 2.14CX LogD: 1.99Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.45Np Likeness Score: -0.36
References 1. Chenna BC, Li L, Mellott DM, Zhai X, Siqueira-Neto JL, Calvet Alvarez C, Bernatchez JA, Desormeaux E, Alvarez Hernandez E, Gomez J, McKerrow JH, Cruz-Reyes J, Meek TD.. (2020) Peptidomimetic Vinyl Heterocyclic Inhibitors of Cruzain Effect Antitrypanosomal Activity., 63 (6): [PMID:32125159 ] [10.1021/acs.jmedchem.9b02078 ]