4,4'-(8-(4-methyl-2-oxo-2H-chromen-7-yloxy)imidazo[1,2-a]pyrazine-3,6-diyl)bis(4,1-phenylene)diboronic acid

ID: ALA4553125

PubChem CID: 155510387

Max Phase: Preclinical

Molecular Formula: C28H21B2N3O7

Molecular Weight: 533.11

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(=O)oc2cc(Oc3nc(-c4ccc(B(O)O)cc4)cn4c(-c5ccc(B(O)O)cc5)cnc34)ccc12

Standard InChI:  InChI=1S/C28H21B2N3O7/c1-16-12-26(34)40-25-13-21(10-11-22(16)25)39-28-27-31-14-24(18-4-8-20(9-5-18)30(37)38)33(27)15-23(32-28)17-2-6-19(7-3-17)29(35)36/h2-15,35-38H,1H3

Standard InChI Key:  ZWJMDXBPJUUVBG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
   40.4342  -15.3972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.1438  -14.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1410  -14.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4324  -13.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7261  -14.9883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7284  -14.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0225  -13.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3138  -14.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3155  -14.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0220  -15.3953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8522  -15.3953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.4289  -12.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6087  -15.4002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.9001  -14.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4879  -14.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4925  -15.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2009  -15.4062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.1957  -13.7713    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9022  -14.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5055  -13.6292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.1718  -12.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3623  -12.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8151  -12.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0665  -11.5946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5184  -10.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7187  -11.1619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4701  -11.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0199  -12.5465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7879  -15.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0775  -15.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3727  -15.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3771  -16.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0922  -16.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7941  -16.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6724  -16.6536    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   31.9617  -16.2502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6783  -17.4708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.1691  -10.5572    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   34.4179   -9.7788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3705  -10.7309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  2 11  2  0
  4 12  1  0
  9 13  1  0
 13 14  1  0
 14 19  1  0
 18 15  1  0
 15 16  2  0
 16 17  1  0
 17 14  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 18  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 22 23  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 16 29  1  0
 32 35  1  0
 35 36  1  0
 35 37  1  0
 26 38  1  0
 38 39  1  0
 38 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4553125

    ---

Associated Targets(Human)

A498 (42825 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 533.11Molecular Weight (Monoisotopic): 533.1566AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Singh H, Singh JV, Bhagat K, Gulati HK, Sanduja M, Kumar N, Kinarivala N, Sharma S..  (2019)  Rational approaches, design strategies, structure activity relationship and mechanistic insights for therapeutic coumarin hybrids.,  27  (16): [PMID:31255497] [10.1016/j.bmc.2019.06.033]

Source