3-(4-decylphenyl)sulfonyl-N-(2-naphthylmethyl)-7-azabicyclo[2.2.1]heptan-2-amine

ID: ALA4553173

PubChem CID: 155510399

Max Phase: Preclinical

Molecular Formula: C33H44N2O2S

Molecular Weight: 532.79

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCc1ccc(S(=O)(=O)C2C3CCC(N3)C2NCc2ccc3ccccc3c2)cc1

Standard InChI:  InChI=1S/C33H44N2O2S/c1-2-3-4-5-6-7-8-9-12-25-16-19-29(20-17-25)38(36,37)33-31-22-21-30(35-31)32(33)34-24-26-15-18-27-13-10-11-14-28(27)23-26/h10-11,13-20,23,30-35H,2-9,12,21-22,24H2,1H3

Standard InChI Key:  FYNBPNBJINMBSG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   18.9701  -13.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7364  -13.7554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7364  -12.3317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1761  -13.0435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3784  -13.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9739  -13.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5342  -13.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7476  -14.7735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5438  -14.9913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7573  -15.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5577  -16.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7692  -16.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1863  -17.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3911  -17.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1710  -16.3738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4015  -18.1827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1992  -18.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7802  -17.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5662  -17.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7700  -13.0478    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.9836  -12.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4011  -11.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6148  -10.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4112  -10.6584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9955  -11.2394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7847  -12.0368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6247   -9.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0421   -9.2753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2556   -8.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6730   -7.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8864   -7.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2996   -6.5135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5173   -5.7131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9305   -5.1304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1440   -4.3343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5614   -3.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9841  -13.8503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5658  -13.2669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  0
  5  4  1  0
  1  5  1  0
  6  4  1  0
  7  6  1  0
  2  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 12 19  1  0
  6 20  1  0
 20 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
 24 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 20 37  2  0
 20 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4553173

    ---

Associated Targets(non-human)

PMII Plasmepsin 2 (774 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmepsin 4 (112 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 532.79Molecular Weight (Monoisotopic): 532.3123AlogP: 6.96#Rotatable Bonds: 14
Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 8.08CX LogP: 8.09CX LogD: 7.33
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.22Np Likeness Score: -0.06

References

1. Bobrovs R, Jaudzems K, Jirgensons A..  (2019)  Exploiting Structural Dynamics To Design Open-Flap Inhibitors of Malarial Aspartic Proteases.,  62  (20): [PMID:31062983] [10.1021/acs.jmedchem.9b00184]

Source