2-methoxy-4-[4-methyl-5-(4-piperazin-1-ylphenyl)-3-pyridyl]benzamide

ID: ALA4553210

PubChem CID: 139582022

Max Phase: Preclinical

Molecular Formula: C24H26N4O2

Molecular Weight: 402.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(-c2cncc(-c3ccc(N4CCNCC4)cc3)c2C)ccc1C(N)=O

Standard InChI:  InChI=1S/C24H26N4O2/c1-16-21(17-3-6-19(7-4-17)28-11-9-26-10-12-28)14-27-15-22(16)18-5-8-20(24(25)29)23(13-18)30-2/h3-8,13-15,26H,9-12H2,1-2H3,(H2,25,29)

Standard InChI Key:  GFEAXKZXFORDDU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    3.1477   -5.0393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1465   -5.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8546   -6.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5683   -5.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5655   -5.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8528   -4.6263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8604   -7.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1468   -7.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1463   -8.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8544   -8.7332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5687   -8.3204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5657   -7.5012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8630   -9.5518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1498   -9.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1488  -10.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8592  -11.1935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5683  -10.7854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5710   -9.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2808   -6.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2728   -4.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9864   -5.0334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6963   -4.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6936   -3.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9753   -3.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2684   -3.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9693   -2.5694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6781   -2.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4034   -3.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1173   -3.7893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3992   -2.5630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
  4 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  5 20  1  0
 24 26  1  0
 26 27  1  0
 23 28  1  0
 28 29  1  0
 28 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4553210

    ---

Associated Targets(Human)

TGFBR1 Tchem TGF-beta receptor type I (3786 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ACVR1 Tchem Activin receptor type-1 (1516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.50Molecular Weight (Monoisotopic): 402.2056AlogP: 3.24#Rotatable Bonds: 5
Polar Surface Area: 80.48Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.54CX Basic pKa: 8.88CX LogP: 2.83CX LogD: 1.34
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.68Np Likeness Score: -0.60

References

1. Ensan D, Smil D, Zepeda-Velázquez CA, Panagopoulos D, Wong JF, Williams EP, Adamson R, Bullock AN, Kiyota T, Aman A, Roberts OG, Edwards AM, O'Meara JA, Isaac MB, Al-Awar R..  (2020)  Targeting ALK2: An Open Science Approach to Developing Therapeutics for the Treatment of Diffuse Intrinsic Pontine Glioma.,  63  (9): [PMID:32369358] [10.1021/acs.jmedchem.0c00395]

Source