The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzyl ((S)-1-Oxo-3-phenyl-1-(((S,E)-4-(pyrimidin-2-yl)but-3-en-2-yl)amino)propan-2-yl)carbamate ID: ALA4553211
PubChem CID: 155555416
Max Phase: Preclinical
Molecular Formula: C25H26N4O3
Molecular Weight: 430.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](/C=C/c1ncccn1)NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1
Standard InChI: InChI=1S/C25H26N4O3/c1-19(13-14-23-26-15-8-16-27-23)28-24(30)22(17-20-9-4-2-5-10-20)29-25(31)32-18-21-11-6-3-7-12-21/h2-16,19,22H,17-18H2,1H3,(H,28,30)(H,29,31)/b14-13+/t19-,22-/m0/s1
Standard InChI Key: SFCIWRSHBYODBA-SMNLDCJUSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
11.2096 -7.8294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8418 -8.2620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5480 -7.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2572 -8.2567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5449 -7.0336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9634 -7.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6726 -8.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3788 -7.8401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6757 -9.0685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0880 -8.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7942 -7.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0911 -9.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5034 -8.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9603 -7.0282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6665 -6.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3733 -7.0272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0790 -6.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0763 -5.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3621 -5.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6594 -5.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9184 -8.2381 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6240 -7.8275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6213 -7.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9071 -6.6038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2044 -7.0167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1340 -7.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4299 -8.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7254 -7.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0218 -8.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0225 -9.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7326 -9.4853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4333 -9.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
3 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
10 12 1 6
11 13 2 0
13 1 1 0
6 14 1 1
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
1 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 1 1 0
2 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.51Molecular Weight (Monoisotopic): 430.2005AlogP: 3.53#Rotatable Bonds: 9Polar Surface Area: 93.21Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.24CX Basic pKa: 1.89CX LogP: 4.23CX LogD: 4.23Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -0.22
References 1. Chenna BC, Li L, Mellott DM, Zhai X, Siqueira-Neto JL, Calvet Alvarez C, Bernatchez JA, Desormeaux E, Alvarez Hernandez E, Gomez J, McKerrow JH, Cruz-Reyes J, Meek TD.. (2020) Peptidomimetic Vinyl Heterocyclic Inhibitors of Cruzain Effect Antitrypanosomal Activity., 63 (6): [PMID:32125159 ] [10.1021/acs.jmedchem.9b02078 ]