1-{3-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]propyl}-3-(5-methoxy-1H-indol-3-yl)pyrrolidine-2,5-dione

ID: ALA4553259

PubChem CID: 155555638

Max Phase: Preclinical

Molecular Formula: C29H31FN4O3

Molecular Weight: 502.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2[nH]cc(C3CC(=O)N(CCCN4CCC(c5c[nH]c6ccc(F)cc56)CC4)C3=O)c2c1

Standard InChI:  InChI=1S/C29H31FN4O3/c1-37-20-4-6-27-22(14-20)25(17-32-27)23-15-28(35)34(29(23)36)10-2-9-33-11-7-18(8-12-33)24-16-31-26-5-3-19(30)13-21(24)26/h3-6,13-14,16-18,23,31-32H,2,7-12,15H2,1H3

Standard InChI Key:  HTBNSFRRWPXBKN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    7.3535  -17.2932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1391  -17.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6120  -16.8626    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1160  -16.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3393  -16.4720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3590  -15.4202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4332  -16.8484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8582  -17.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6794  -17.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1002  -18.2351    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7006  -18.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1179  -19.6455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9354  -19.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3338  -18.9209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9148  -18.2163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3573  -20.3382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0351  -21.0892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6498  -21.6277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3487  -21.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1710  -20.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7661  -19.8621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5421  -20.1008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7243  -20.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1249  -21.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4093  -18.3088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7001  -17.7888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7144  -18.6099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9376  -18.8761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4417  -18.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9164  -17.5494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5710  -16.8111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7551  -16.7331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2859  -17.4078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6299  -18.1476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4116  -15.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5977  -15.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1409  -19.5447    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  4  6  2  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 10 15  1  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 20 19  2  0
 20 16  1  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
  2 25  2  0
  1 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  1  0
 29 30  2  0
 26 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
 35 36  1  0
 22 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4553259

    ---

Associated Targets(Human)

SLC6A4 Tclin Serotonin transporter (12625 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HTR1A Tclin Serotonin 1a (5-HT1a) receptor (14969 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.59Molecular Weight (Monoisotopic): 502.2380AlogP: 4.91#Rotatable Bonds: 7
Polar Surface Area: 81.43Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.00CX LogP: 3.44CX LogD: 1.84
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.35Np Likeness Score: -0.81

References

1. Wróbel MZ, Chodkowski A, Herold F, Marciniak M, Dawidowski M, Siwek A, Starowicz G, Stachowicz K, Szewczyk B, Nowak G, Belka M, Bączek T, Satała G, Bojarski AJ, Turło J..  (2019)  Synthesis and biological evaluation of new multi-target 3-(1H-indol-3-yl)pyrrolidine-2,5-dione derivatives with potential antidepressant effect.,  183  [PMID:31586817] [10.1016/j.ejmech.2019.111736]

Source