(3-(6-Amino-2-methyl-9H-purin-9-yl)-3-methylazetidin-1-yl)(5-((4-cycloheptylpiperazin-1-yl)methyl)-1-methyl-1H-pyrazol-3-yl)methanone

ID: ALA4553357

PubChem CID: 155555569

Max Phase: Preclinical

Molecular Formula: C27H40N10O

Molecular Weight: 520.69

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc(N)c2ncn(C3(C)CN(C(=O)c4cc(CN5CCN(C6CCCCCC6)CC5)n(C)n4)C3)c2n1

Standard InChI:  InChI=1S/C27H40N10O/c1-19-30-24(28)23-25(31-19)37(18-29-23)27(2)16-36(17-27)26(38)22-14-21(33(3)32-22)15-34-10-12-35(13-11-34)20-8-6-4-5-7-9-20/h14,18,20H,4-13,15-17H2,1-3H3,(H2,28,30,31)

Standard InChI Key:  FTKQUUUDTGVWAB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   37.2892  -13.4203    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0030  -13.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0002  -12.1799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2874  -11.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5771  -13.0072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5783  -12.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7980  -11.9330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3170  -12.5971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7960  -13.2624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.5423  -14.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8066  -14.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1807  -15.1441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9093  -14.7701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9229  -15.9251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1192  -16.0938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4729  -16.5373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5143  -15.5460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8018  -15.9577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9706  -16.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7873  -16.8479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4188  -17.3721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6156  -17.1969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3677  -16.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5684  -16.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0132  -16.8524    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2672  -17.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0722  -17.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2837  -10.9534    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0516  -15.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7117  -13.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2191  -16.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7183  -17.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8993  -17.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0269  -15.8842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3797  -16.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2846  -15.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5534  -15.9060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3279  -13.8262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 10  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
  4 28  1  0
 18 29  1  0
  2 30  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 33 35  1  0
 34 36  1  0
 35 37  1  0
 36 37  1  0
 25 31  1  0
 10 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4553357

    ---

Associated Targets(Human)

SMYD2 Tchem N-lysine methyltransferase SMYD2 (395 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 520.69Molecular Weight (Monoisotopic): 520.3387AlogP: 2.16#Rotatable Bonds: 5
Polar Surface Area: 114.23Molecular Species: BASEHBA: 10HBD: 1
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 8.90CX LogP: 1.85CX LogD: 0.34
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.51Np Likeness Score: -1.09

References

1. Taylor AP, Swewczyk M, Kennedy S, Trush VV, Wu H, Zeng H, Dong A, Ferreira de Freitas R, Tatlock J, Kumpf RA, Wythes M, Casimiro-Garcia A, Denny RA, Parikh MD, Li F, Barsyte-Lovejoy D, Schapira M, Vedadi M, Brown PJ, Arrowsmith CH, Owen DR..  (2019)  Selective, Small-Molecule Co-Factor Binding Site Inhibition of a Su(var)3-9, Enhancer of Zeste, Trithorax Domain Containing Lysine Methyltransferase.,  62  (17): [PMID:31415173] [10.1021/acs.jmedchem.9b00112]

Source