2-(2-Methylphenoxy)-N-(7-quinazolinyl)acetamide

ID: ALA4553417

PubChem CID: 155555875

Max Phase: Preclinical

Molecular Formula: C17H15N3O2

Molecular Weight: 293.33

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccccc1OCC(=O)Nc1ccc2cncnc2c1

Standard InChI:  InChI=1S/C17H15N3O2/c1-12-4-2-3-5-16(12)22-10-17(21)20-14-7-6-13-9-18-11-19-15(13)8-14/h2-9,11H,10H2,1H3,(H,20,21)

Standard InChI Key:  ATQVXQRNULONIM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
    2.1778  -16.0838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1766  -16.9033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8847  -17.3123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5943  -16.9028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5915  -16.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8829  -15.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2977  -15.6689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0069  -16.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7131  -15.6636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4223  -16.0695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7100  -14.8464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1285  -15.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8804  -14.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8337  -16.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8225  -14.4315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1198  -14.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5368  -14.8373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2431  -14.4263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9522  -14.8324    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9550  -15.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2487  -16.0606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5396  -15.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
  6 13  1  0
 12 14  2  0
 14 22  1  0
 17 15  1  0
 15 16  2  0
 16 12  1  0
 17 22  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4553417

    ---

Associated Targets(Human)

NOTUM Tchem Palmitoleoyl-protein carboxylesterase NOTUM (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 293.33Molecular Weight (Monoisotopic): 293.1164AlogP: 2.96#Rotatable Bonds: 4
Polar Surface Area: 64.11Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.36CX Basic pKa: 2.15CX LogP: 2.69CX LogD: 2.69
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.80Np Likeness Score: -1.89

References

1. Atkinson BN, Steadman D, Zhao Y, Sipthorp J, Vecchia L, Ruza RR, Jeganathan F, Lines G, Frew S, Monaghan A, Kjær S, Bictash M, Jones EY, Fish PV..  (2019)  Discovery of 2-phenoxyacetamides as inhibitors of the Wnt-depalmitoleating enzyme NOTUM from an X-ray fragment screen.,  10  (8): [PMID:31534655] [10.1039/C9MD00096H]

Source