The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(1-(6-((R)-3-(2-hydroxypropan-2-yl)pyrrolidin-1-yl)pyrimidin-4-yl)-1H-indazol-6-yl)spiro[2.3]hexane-5-carbonitrile ID: ALA4553532
PubChem CID: 138550552
Max Phase: Preclinical
Molecular Formula: C25H28N6O
Molecular Weight: 428.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(O)[C@@H]1CCN(c2cc(-n3ncc4ccc(C5(C#N)CC6(CC6)C5)cc43)ncn2)C1
Standard InChI: InChI=1S/C25H28N6O/c1-23(2,32)19-5-8-30(12-19)21-10-22(28-16-27-21)31-20-9-18(4-3-17(20)11-29-31)25(15-26)13-24(14-25)6-7-24/h3-4,9-11,16,19,32H,5-8,12-14H2,1-2H3/t19-/m1/s1
Standard InChI Key: ZLDGCNVJLNOXNX-LJQANCHMSA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
18.8078 -5.1467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2205 -4.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4029 -4.4363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9319 -2.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9307 -3.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6388 -3.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6370 -2.2325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3456 -2.6378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3504 -3.4564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1304 -3.7049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6078 -3.0397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1227 -2.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3862 -4.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8412 -5.0864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0976 -5.8615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8987 -6.0273 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4428 -5.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1835 -4.6393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2437 -5.5744 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2256 -3.8658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4364 -3.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0135 -4.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8728 -4.3616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5204 -4.8601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5808 -6.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3927 -6.2238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5552 -5.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8436 -5.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9452 -6.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6999 -7.6055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7429 -6.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5204 -7.4001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
10 13 1 0
17 19 1 0
20 21 1 0
21 2 1 0
2 22 1 0
22 20 1 0
5 20 1 0
23 24 3 0
20 23 1 0
19 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 19 1 0
26 29 1 1
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.54Molecular Weight (Monoisotopic): 428.2325AlogP: 3.75#Rotatable Bonds: 4Polar Surface Area: 90.86Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.81CX LogP: 3.42CX LogD: 3.42Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.68Np Likeness Score: -0.63
References 1. Abdel-Magid AF.. (2019) LRRK2 Kinase Inhibitors as Possible Therapy for Parkinson's Disease and Other Neurodegenerative Disorders., 10 (6): [PMID:31223436 ] [10.1021/acsmedchemlett.9b00216 ]