The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-(4-Aminophenyl)-4-(4-nitrophenyl)-1H-pyrrol-3-yl)(3,4,5-trimethoxyphenyl)-methanone ID: ALA4553655
PubChem CID: 155510394
Max Phase: Preclinical
Molecular Formula: C26H23N3O6
Molecular Weight: 473.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)c2cn(-c3ccc(N)cc3)cc2-c2ccc([N+](=O)[O-])cc2)cc(OC)c1OC
Standard InChI: InChI=1S/C26H23N3O6/c1-33-23-12-17(13-24(34-2)26(23)35-3)25(30)22-15-28(19-10-6-18(27)7-11-19)14-21(22)16-4-8-20(9-5-16)29(31)32/h4-15H,27H2,1-3H3
Standard InChI Key: ZUMVIGJIGCEVEU-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
18.8245 -13.7628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6399 -13.7639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0468 -13.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6395 -12.3534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8209 -12.3562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4177 -13.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6005 -13.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1898 -12.3572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1940 -13.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7854 -15.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4484 -14.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3768 -13.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1225 -14.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9641 -13.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3755 -12.3507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9635 -11.6413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1414 -11.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7332 -12.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1475 -13.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7847 -15.8473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0754 -16.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0751 -17.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7833 -17.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4934 -17.0681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4902 -16.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0480 -14.4720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8640 -13.0597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0469 -11.6450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8641 -11.6437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6388 -15.1794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2725 -13.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7844 -18.2983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7256 -10.9372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9084 -10.9407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1311 -10.2277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 2 0
7 9 1 0
12 13 2 0
11 9 2 0
10 11 1 0
9 12 1 0
13 10 1 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
10 20 1 0
2 26 1 0
3 27 1 0
4 28 1 0
28 29 1 0
26 30 1 0
27 31 1 0
23 32 1 0
33 34 2 0
33 35 1 0
17 33 1 0
M CHG 2 33 1 35 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.49Molecular Weight (Monoisotopic): 473.1587AlogP: 4.89#Rotatable Bonds: 8Polar Surface Area: 118.85Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.64CX LogP: 4.68CX LogD: 4.68Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: -0.59
References 1. Puxeddu M, Shen H, Bai R, Coluccia A, Nalli M, Mazzoccoli C, Da Pozzo E, Cavallini C, Martini C, Orlando V, Biagioni S, Mazzoni C, Coluccia AML, Hamel E, Liu T, Silvestri R, La Regina G.. (2020) Structure-activity relationship studies and in vitro and in vivo anticancer activity of novel 3-aroyl-1,4-diarylpyrroles against solid tumors and hematological malignancies., 185 [PMID:31727471 ] [10.1016/j.ejmech.2019.111828 ]