The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-((S)-2-((S)-2-Acetamido-3-phenylpropanamido)-propanamido)-5-(((S)-1-amino-4-(methylthio)-1-oxobutan-2-yl)amino)-5-oxopentanoic Acid ID: ALA4553664
PubChem CID: 155510391
Max Phase: Preclinical
Molecular Formula: C24H35N5O7S
Molecular Weight: 537.64
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CSCC[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(C)=O)C(N)=O
Standard InChI: InChI=1S/C24H35N5O7S/c1-14(26-24(36)19(27-15(2)30)13-16-7-5-4-6-8-16)22(34)29-18(9-10-20(31)32)23(35)28-17(21(25)33)11-12-37-3/h4-8,14,17-19H,9-13H2,1-3H3,(H2,25,33)(H,26,36)(H,27,30)(H,28,35)(H,29,34)(H,31,32)/t14-,17-,18-,19-/m0/s1
Standard InChI Key: BYTFPOUVGJUVFP-QZHFEQFPSA-N
Molfile:
RDKit 2D
37 37 0 0 0 0 0 0 0 0999 V2000
2.4740 -12.7980 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1834 -12.3895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8887 -13.6152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8887 -12.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1834 -11.5723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7687 -11.5723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4740 -11.1637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4740 -10.3465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7687 -9.9338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0552 -10.3465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0552 -11.1637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5981 -12.3895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3034 -12.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0128 -11.5723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3034 -13.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0128 -12.3895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7181 -12.7980 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4316 -12.3895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8463 -12.3895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1410 -12.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4316 -11.5723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1410 -11.1637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1410 -10.3465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4316 -9.9338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8463 -9.9338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1410 -13.6152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8463 -14.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5557 -15.2537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8463 -14.8410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5557 -13.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2610 -14.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2610 -14.8410 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.9704 -15.2537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1410 -15.2537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4740 -13.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1834 -14.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7687 -14.0238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4 12 1 0
16 17 1 0
20 26 1 0
29 34 1 0
1 2 1 0
2 4 1 0
4 3 2 0
2 5 1 1
5 7 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
12 13 1 0
13 16 1 0
16 14 2 0
13 15 1 6
17 18 1 0
18 20 1 0
20 19 2 0
18 21 1 1
21 22 1 0
22 23 1 0
23 24 2 0
23 25 1 0
27 26 1 1
27 29 1 0
29 28 2 0
27 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
1 35 1 0
35 36 1 0
35 37 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.64Molecular Weight (Monoisotopic): 537.2257AlogP: -0.69#Rotatable Bonds: 16Polar Surface Area: 196.79Molecular Species: ACIDHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 4.10CX Basic pKa: ┄CX LogP: -1.22CX LogD: -4.32Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.16Np Likeness Score: -0.22
References 1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A.. (2018) Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model., 61 (24): [PMID:30507195 ] [10.1021/acs.jmedchem.8b01471 ]