(7R,10R,11R,21S,23S)-23-Fluoro-21-hydroxy-10-isopropyl-11,19-dimethyl-9,26-dioxa-3,15,28-triaza-tricyclo[23.2.1.0(3,7)]octacosa-1(27),12,17,19,25(28)-pentaene-2,8,14-trione

ID: ALA4553689

PubChem CID: 155510437

Max Phase: Preclinical

Molecular Formula: C28H38FN3O6

Molecular Weight: 531.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1=C\[C@@H](O)C[C@H](F)Cc2nc(co2)C(=O)N2CCC[C@@H]2C(=O)O[C@H](C(C)C)[C@H](C)/C=C/C(=O)NC\C=C\1

Standard InChI:  InChI=1S/C28H38FN3O6/c1-17(2)26-19(4)9-10-24(34)30-11-5-7-18(3)13-21(33)14-20(29)15-25-31-22(16-37-25)27(35)32-12-6-8-23(32)28(36)38-26/h5,7,9-10,13,16-17,19-21,23,26,33H,6,8,11-12,14-15H2,1-4H3,(H,30,34)/b7-5+,10-9+,18-13+/t19-,20+,21-,23-,26-/m1/s1

Standard InChI Key:  DFSJQGCLWZVMOD-MRNFZBEQSA-N

Molfile:  

 
     RDKit          2D

 39 41  0  0  0  0  0  0  0  0999 V2000
    3.7929  -13.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4941  -13.9954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7929  -12.7779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0839  -11.5674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0870  -12.3821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7850  -11.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4871   -9.9423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7819  -10.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1894  -10.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5899  -10.3569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8882   -9.9474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1918  -13.5909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8897  -14.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5997  -13.5969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6651  -11.1603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4561  -11.3369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8698  -10.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3344  -10.0333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1938  -12.7779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3004  -14.0105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0068  -13.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2947  -14.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7075  -14.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4140  -13.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7018  -14.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0126  -12.7938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7190  -12.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4197  -12.8038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5681  -10.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2763  -10.6237    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5589   -9.4101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3708  -11.4286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1679  -11.5895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5685  -10.8812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0148  -10.2803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7733  -12.1299    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0781   -9.9408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3783  -11.1623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1880  -11.1600    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0
  1  2  1  0
  2 12  1  0
  3  5  2  0
  6  4  2  0
  4  5  1  0
  6  8  1  0
  9  7  1  0
  7  8  1  0
  9 11  1  0
 10 11  1  0
 12 13  1  0
 13 14  2  0
 10 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 10  2  0
 12 19  2  0
 14 20  1  0
 20 21  1  0
 20 22  1  6
 21 23  1  6
 23 24  1  0
 23 25  1  0
 21 26  1  0
 26 27  1  0
 27 28  2  0
 17 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 30  1  0
 27 32  1  0
 32 36  1  1
  8 37  1  1
  4 38  1  0
  9 39  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4553689

    ---

Associated Targets(non-human)

rpsB Bacterial 70S ribosome (328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Staphylococcus hominis (482 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 531.63Molecular Weight (Monoisotopic): 531.2745AlogP: 3.30#Rotatable Bonds: 1
Polar Surface Area: 121.97Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 2.42CX LogD: 2.42
Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.53Np Likeness Score: 1.44

References

1. Meanwell NA..  (2018)  Fluorine and Fluorinated Motifs in the Design and Application of Bioisosteres for Drug Design.,  61  (14): [PMID:29400967] [10.1021/acs.jmedchem.7b01788]

Source