(S)-1-((4-(2-((2-Aminoethyl)disulfanyl)ethoxy)-3-methoxyphenethyl)amino)-3-(4-(2-methoxyethyl)phenoxy)propan-2-ol

ID: ALA4553747

PubChem CID: 155555687

Max Phase: Preclinical

Molecular Formula: C25H38N2O5S2

Molecular Weight: 510.72

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCCc1ccc(OC[C@@H](O)CNCCc2ccc(OCCSSCCN)c(OC)c2)cc1

Standard InChI:  InChI=1S/C25H38N2O5S2/c1-29-13-10-20-3-6-23(7-4-20)32-19-22(28)18-27-12-9-21-5-8-24(25(17-21)30-2)31-14-16-34-33-15-11-26/h3-8,17,22,27-28H,9-16,18-19,26H2,1-2H3/t22-/m0/s1

Standard InChI Key:  DMFJWPHVIMGYIO-QFIPXVFZSA-N

Molfile:  

 
     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
    5.7699  -26.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4817  -25.6218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1935  -26.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9012  -25.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6131  -26.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9012  -24.8005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3249  -25.6218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0368  -26.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7486  -25.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3467  -26.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0635  -27.2616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7719  -26.8513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3471  -26.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0564  -25.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4604  -26.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4586  -26.8569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1696  -27.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8782  -26.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8756  -26.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1682  -25.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5860  -25.6160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5906  -27.2645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5831  -24.7947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3019  -26.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0143  -27.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7256  -26.8530    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.4380  -27.2607    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.1493  -26.8512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8616  -27.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5688  -26.8493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6354  -27.2627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9230  -26.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2117  -27.2646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5094  -26.8569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  1  1
  5  7  1  0
  7  8  1  0
  8  9  1  0
  1 14  2  0
 13 10  2  0
 10 11  1  0
 11 12  2  0
 12  1  1  0
 13 14  1  0
  9 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 18 22  1  0
 21 23  1  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 10 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4553747

    ---

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Adrb1 Beta-1 adrenergic receptor (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 510.72Molecular Weight (Monoisotopic): 510.2222AlogP: 3.18#Rotatable Bonds: 19
Polar Surface Area: 95.20Molecular Species: BASEHBA: 9HBD: 3
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.79CX LogP: 2.56CX LogD: -1.49
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.19Np Likeness Score: -0.27

References

1. Schwalbe T, Huebner H, Gmeiner P..  (2019)  Development of covalent antagonists for β1- and β2-adrenergic receptors.,  27  (13): [PMID:31151791] [10.1016/j.bmc.2019.05.034]

Source