2-(3,4-dimethoxyphenyl)-5-(2-(1-methyl-1H-pyrazol-4-yl)-5-(trifluoromethoxy)phenyl)-1,3,4-oxadiazole

ID: ALA4553780

PubChem CID: 155555880

Max Phase: Preclinical

Molecular Formula: C21H17F3N4O4

Molecular Weight: 446.39

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2nnc(-c3cc(OC(F)(F)F)ccc3-c3cnn(C)c3)o2)cc1OC

Standard InChI:  InChI=1S/C21H17F3N4O4/c1-28-11-13(10-25-28)15-6-5-14(32-21(22,23)24)9-16(15)20-27-26-19(31-20)12-4-7-17(29-2)18(8-12)30-3/h4-11H,1-3H3

Standard InChI Key:  ZFKPRJZBVPNLEF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   33.9492  -13.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9480  -14.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6561  -14.5264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3657  -14.1170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3629  -13.2943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6543  -12.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6518  -12.0718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3583  -11.6611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3559  -10.8440    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.0672  -12.0676    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.0637  -11.2467    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.0741  -14.5244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1613  -15.3346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9609  -15.5032    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.3684  -14.7948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8206  -14.1885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.1851  -14.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5941  -15.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4100  -15.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8167  -14.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4015  -14.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5869  -14.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6339  -14.7844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.0459  -15.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8051  -13.3697    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.6223  -13.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6559  -15.3436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9996  -15.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2520  -16.6010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0692  -16.6012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3218  -15.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5495  -17.2624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
  4 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
 23 24  1  0
 21 25  1  0
 25 26  1  0
  3 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 27  2  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4553780

    ---

Associated Targets(non-human)

Grm7 Metabotropic glutamate receptor 7 (580 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.39Molecular Weight (Monoisotopic): 446.1202AlogP: 4.72#Rotatable Bonds: 6
Polar Surface Area: 84.43Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.80CX LogP: 4.20CX LogD: 4.20
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: -1.16

References

1. Reed CW, Washecheck JP, Quitlag MC, Jenkins MT, Rodriguez AL, Engers DW, Blobaum AL, Conn PJ, Niswender CM, Lindsley CW..  (2019)  Surveying heterocycles as amide bioisosteres within a series of mGlu7 NAMs: Discovery of VU6019278.,  29  (10): [PMID:30910459] [10.1016/j.bmcl.2019.03.016]

Source