The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,4,6-Tri-O-acetyl-2-deoxy-2-acetamido-beta-D-glucopyranosyl-16-oxo-ent-beyeran-19-oate ID: ALA4553867
PubChem CID: 155555387
Max Phase: Preclinical
Molecular Formula: C34H49NO11
Molecular Weight: 647.76
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@H]1[C@H](OC(=O)[C@]2(C)CCC[C@@]3(C)[C@@H]4CC[C@@]5(C)C[C@]4(CC[C@@H]32)CC5=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O
Standard InChI: InChI=1S/C34H49NO11/c1-18(36)35-26-28(44-21(4)39)27(43-20(3)38)22(16-42-19(2)37)45-29(26)46-30(41)33(7)12-8-11-32(6)23(33)10-14-34-15-25(40)31(5,17-34)13-9-24(32)34/h22-24,26-29H,8-17H2,1-7H3,(H,35,36)/t22-,23+,24+,26-,27-,28-,29+,31+,32-,33-,34+/m1/s1
Standard InChI Key: MTKWIZXKEVXYDH-NVDHHWNFSA-N
Molfile:
RDKit 2D
48 52 0 0 0 0 0 0 0 0999 V2000
34.2511 -18.5383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0683 -18.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4747 -17.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0722 -17.1300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8445 -17.8294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.2550 -17.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4760 -19.2488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2919 -17.8386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8406 -19.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8505 -16.4128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0343 -16.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6299 -15.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2250 -16.4073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9324 -14.4907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9324 -15.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6335 -14.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3347 -14.4907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3312 -15.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0291 -15.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7350 -15.3097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0361 -14.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7385 -14.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4504 -14.1053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4620 -13.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7554 -12.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0414 -13.2721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0348 -13.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5189 -14.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3274 -13.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5748 -12.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8418 -13.7597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3232 -16.1168 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
34.0290 -14.9034 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
32.6253 -17.1173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6986 -18.5475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5157 -18.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2880 -19.2540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0234 -19.2426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0665 -19.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4741 -20.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2493 -19.9549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4859 -16.4252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3030 -16.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7167 -15.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7065 -17.1417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6128 -19.9492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7957 -19.9469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0195 -20.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 6 1 0
1 5 1 0
5 6 1 0
2 7 1 6
3 8 1 1
1 9 1 1
6 10 1 1
12 11 1 6
13 12 1 0
14 15 1 0
14 16 1 0
15 12 1 0
12 18 1 0
17 16 1 0
17 18 1 0
17 21 1 0
18 19 1 0
19 20 1 0
20 22 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
22 28 1 6
28 27 1 0
17 29 1 6
24 30 1 1
27 31 2 0
18 32 1 1
21 33 1 1
11 34 2 0
11 10 1 0
8 35 1 0
35 36 1 0
35 37 2 0
9 38 1 0
7 39 1 0
39 40 1 0
39 41 2 0
4 42 1 6
42 43 1 0
43 44 1 0
43 45 2 0
38 46 1 0
46 47 2 0
46 48 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 647.76Molecular Weight (Monoisotopic): 647.3306AlogP: 3.56#Rotatable Bonds: 7Polar Surface Area: 160.60Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.38CX Basic pKa: ┄CX LogP: 3.27CX LogD: 3.27Aromatic Rings: ┄Heavy Atoms: 46QED Weighted: 0.32Np Likeness Score: 2.04
References 1. Sharipova RR, Belenok MG, Garifullin BF, Sapunova AS, Voloshina AD, Andreeva OV, Strobykina IY, Skvortsova PV, Zuev YF, Kataev VE.. (2019) Synthesis and anti-cancer activities of glycosides and glycoconjugates of diterpenoid isosteviol., 10 (8): [PMID:31673312 ] [10.1039/C9MD00242A ]