5-Chloro-3-[2-(hexahydro-1H-azepin-1-yl)ethyl]-2(3H)-benzoxazolone

ID: ALA4553933

PubChem CID: 155555743

Max Phase: Preclinical

Molecular Formula: C15H19ClN2O2

Molecular Weight: 294.78

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1oc2ccc(Cl)cc2n1CCN1CCCCCC1

Standard InChI:  InChI=1S/C15H19ClN2O2/c16-12-5-6-14-13(11-12)18(15(19)20-14)10-9-17-7-3-1-2-4-8-17/h5-6,11H,1-4,7-10H2

Standard InChI Key:  HTOCZAQZHVZMBE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
   20.3092   -4.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3081   -5.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0226   -5.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0209   -4.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7361   -4.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7363   -5.2675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5265   -5.5240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0147   -4.8517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5261   -4.1797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5948   -4.0281    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   23.8395   -4.8514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.7807   -3.3953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5874   -3.2236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8420   -2.4391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3424   -1.7868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5367   -0.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6704   -2.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2818   -0.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1937   -1.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0180   -1.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
  8 11  2  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  0
 16 18  1  0
 17 19  1  0
 18 20  1  0
 19 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4553933

    ---

Associated Targets(Human)

TMEM97 Tchem Sigma intracellular receptor 2 (973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

SIGMAR1 Sigma-1 receptor (3326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 294.78Molecular Weight (Monoisotopic): 294.1135AlogP: 3.12#Rotatable Bonds: 3
Polar Surface Area: 38.38Molecular Species: BASEHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.62CX LogP: 3.11CX LogD: 1.87
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.87Np Likeness Score: -1.67

References

1. Romeo G, Prezzavento O, Intagliata S, Pittalà V, Modica MN, Marrazzo A, Turnaturi R, Parenti C, Chiechio S, Arena E, Campisi A, Sposito G, Salerno L..  (2019)  Synthesis, in vitro and in vivo characterization of new benzoxazole and benzothiazole-based sigma receptor ligands.,  174  [PMID:31042618] [10.1016/j.ejmech.2019.04.056]

Source