The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,7S,8S)-8-Benzyl-7-hydroxy-3-phenyl-1,4,9-triazacyclohenicosane-2,5,10-trione ID: ALA4554001
PubChem CID: 155555744
Max Phase: Preclinical
Molecular Formula: C31H43N3O4
Molecular Weight: 521.70
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C[C@H](O)[C@H](Cc2ccccc2)NC(=O)CCCCCCCCCCCNC(=O)[C@H](c2ccccc2)N1
Standard InChI: InChI=1S/C31H43N3O4/c35-27-23-29(37)34-30(25-18-12-9-13-19-25)31(38)32-21-15-7-5-3-1-2-4-6-14-20-28(36)33-26(27)22-24-16-10-8-11-17-24/h8-13,16-19,26-27,30,35H,1-7,14-15,20-23H2,(H,32,38)(H,33,36)(H,34,37)/t26-,27-,30-/m0/s1
Standard InChI Key: BQQIKYDMWMUCPZ-VWYPKUQYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
16.5254 -1.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2166 -1.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9078 -1.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5990 -1.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2902 -1.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9773 -1.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6685 -1.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6685 -2.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5254 -2.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3556 -2.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3556 -3.5783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8342 -2.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8342 -3.4627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1430 -3.8631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5254 -3.8631 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5254 -4.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2166 -5.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9078 -4.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5990 -5.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2902 -4.6596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5990 -5.8565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2166 -5.8565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9773 -5.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8625 -4.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9773 -5.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8174 -5.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4351 -5.2674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8153 -5.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1034 -6.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1010 -7.1129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8123 -7.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5275 -7.1130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5265 -6.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2839 -6.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2836 -7.0455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9745 -7.4466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6672 -7.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6641 -6.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
1 9 1 0
8 10 1 0
10 11 1 0
9 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
17 22 1 6
20 23 1 0
23 24 1 0
23 25 1 6
24 11 1 0
16 26 1 6
24 27 2 0
26 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
25 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 25 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.70Molecular Weight (Monoisotopic): 521.3254AlogP: 4.35#Rotatable Bonds: 3Polar Surface Area: 107.53Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.34CX Basic pKa: ┄CX LogP: 4.38CX LogD: 4.38Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.48Np Likeness Score: 0.40
References 1. Houštecká R, Hadzima M, Fanfrlík J, Brynda J, Pallová L, Hánová I, Mertlíková-Kaiserová H, Lepšík M, Horn M, Smrčina M, Majer P, Mareš M.. (2020) Biomimetic Macrocyclic Inhibitors of Human Cathepsin D: Structure-Activity Relationship and Binding Mode Analysis., 63 (4): [PMID:32003991 ] [10.1021/acs.jmedchem.9b01351 ]