The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(1-(9H-purin-6-yl)pyrrolidin-2-yl)-3-benzylquinazolin-4(3H)-one ID: ALA4554096
PubChem CID: 155555836
Max Phase: Preclinical
Molecular Formula: C24H21N7O
Molecular Weight: 423.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c2ccccc2nc([C@@H]2CCCN2c2ncnc3[nH]cnc23)n1Cc1ccccc1
Standard InChI: InChI=1S/C24H21N7O/c32-24-17-9-4-5-10-18(17)29-22(31(24)13-16-7-2-1-3-8-16)19-11-6-12-30(19)23-20-21(26-14-25-20)27-15-28-23/h1-5,7-10,14-15,19H,6,11-13H2,(H,25,26,27,28)/t19-/m0/s1
Standard InChI Key: GDYACSDCBRVEIQ-IBGZPJMESA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
5.4494 -8.3361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2249 -8.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7256 -7.9568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2549 -7.2787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4697 -7.5163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9136 -6.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9125 -7.1094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6246 -7.5184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6229 -5.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3356 -6.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3344 -7.1069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0448 -7.5160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7608 -7.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7619 -6.2841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0471 -5.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0471 -5.0451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7381 -8.7415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0313 -8.3190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3163 -8.7236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3076 -9.5453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7320 -9.5577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1897 -10.7571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9992 -10.8451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3317 -10.1023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0158 -9.9507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4706 -5.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4726 -5.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1876 -4.6467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1899 -3.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4785 -3.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7675 -3.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7687 -4.6455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 11 2 0
10 9 2 0
9 6 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
5 13 1 6
1 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
21 17 1 0
21 25 2 0
25 22 1 0
22 23 1 0
23 24 2 0
24 21 1 0
20 25 1 0
14 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.48Molecular Weight (Monoisotopic): 423.1808AlogP: 3.45#Rotatable Bonds: 4Polar Surface Area: 92.59Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.83CX Basic pKa: 4.74CX LogP: 3.45CX LogD: 3.44Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -0.84
References 1. Ma X, Fang F, Tao Q, Shen L, Zhong G, Qiao T, Lv X, Li J.. (2019) Conformationally restricted quinazolone derivatives as PI3Kδ-selective inhibitors: the design, synthesis and biological evaluation., 10 (3): [PMID:30996859 ] [10.1039/C8MD00556G ]