5-(3-((3aR,6S,7S,11R,13aR)-2,2,7,11-tetramethyl-4-oxo-4,6,7,8,9,10,11,13a-octahydro-3aH-[1,3]dioxolo[4,5-c][1]oxacyclododecin-6-yl)phenyl)pentanoic acid

ID: ALA4554120

PubChem CID: 155556469

Max Phase: Preclinical

Molecular Formula: C27H38O6

Molecular Weight: 458.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H]1/C=C/[C@H]2OC(C)(C)O[C@H]2C(=O)O[C@H](c2cccc(CCCCC(=O)O)c2)[C@@H](C)CCC1

Standard InChI:  InChI=1S/C27H38O6/c1-18-9-7-10-19(2)24(21-13-8-12-20(17-21)11-5-6-14-23(28)29)31-26(30)25-22(16-15-18)32-27(3,4)33-25/h8,12-13,15-19,22,24-25H,5-7,9-11,14H2,1-4H3,(H,28,29)/b16-15+/t18-,19+,22-,24+,25-/m1/s1

Standard InChI Key:  NJVOQXXHYGYWBY-ROWKGEAZSA-N

Molfile:  

 
     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
    8.0357  -26.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0357  -27.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7451  -27.7804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4511  -27.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1531  -27.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8673  -27.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8707  -26.5565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7451  -26.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1606  -26.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7494  -25.3187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1485  -28.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3227  -26.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5768  -27.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8629  -28.1972    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4514  -26.5603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4676  -24.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1741  -25.3321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7902  -24.7894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4645  -24.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6471  -24.1127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8808  -23.3325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0498  -23.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5680  -28.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2767  -29.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9933  -28.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9968  -27.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2875  -27.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7061  -27.3941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4122  -27.8055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1215  -27.3997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8276  -27.8110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5369  -27.4052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2430  -27.8165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5401  -26.5880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8794  -25.7374    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7539  -24.5034    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  8  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8 10  2  0
  9 17  1  0
 16 10  1  0
  5 11  1  1
  1 12  1  1
  6 13  1  0
  6 14  1  1
  9 15  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
 19 21  1  0
 19 22  1  0
 13 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 13  1  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 17 35  1  6
 16 36  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4554120

    ---

Associated Targets(non-human)

Streptococcus mutans (2687 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.60Molecular Weight (Monoisotopic): 458.2668AlogP: 5.60#Rotatable Bonds: 6
Polar Surface Area: 82.06Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.43CX Basic pKa: CX LogP: 6.22CX LogD: 3.36
Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: 1.33

References

1. Scharnow AM, Solinski AE, Wuest WM..  (2019)  Targeting S. mutans biofilms: a perspective on preventing dental caries.,  10  (7): [PMID:31391878] [10.1039/C9MD00015A]

Source