1-((5-Bromo-4-((4-bromonaphth-1-yl)methyl)-4H-1,2,4-triazol-3-yl)thio)-N-(6-bromopyridin-3-yl)methanesulfonamide

ID: ALA4554148

PubChem CID: 155556604

Max Phase: Preclinical

Molecular Formula: C19H14Br3N5O2S2

Molecular Weight: 648.20

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(CSc1nnc(Br)n1Cc1ccc(Br)c2ccccc12)Nc1ccc(Br)nc1

Standard InChI:  InChI=1S/C19H14Br3N5O2S2/c20-16-7-5-12(14-3-1-2-4-15(14)16)10-27-18(22)24-25-19(27)30-11-31(28,29)26-13-6-8-17(21)23-9-13/h1-9,26H,10-11H2

Standard InChI Key:  QOYHWWWUWRFEQT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   35.8615   -2.1131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.2742   -2.8230    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   36.6826   -2.1107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9487   -5.2940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2352   -5.7061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2349   -6.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9472   -6.9361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6583   -5.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6608   -6.5192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3635   -6.9209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0683   -6.5124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0618   -5.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3544   -5.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9487   -4.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2368   -4.0641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.1485   -3.2492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3450   -3.0793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9322   -3.7912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4832   -4.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8544   -2.8313    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   35.5700   -3.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3137   -5.2019    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   34.9501   -7.7574    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   36.9854   -3.2273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.6903   -2.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3971   -3.2196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1016   -2.8070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.0966   -1.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3812   -1.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6797   -2.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8011   -1.5747    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  4  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  8  2  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 16 20  1  0
 20 21  1  0
 19 22  1  0
  7 23  1  0
 21  2  1  0
  2 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4554148

    ---

Associated Targets(Human)

SLC22A12 Tclin Solute carrier family 22 member 12 (799 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 648.20Molecular Weight (Monoisotopic): 644.8139AlogP: 5.65#Rotatable Bonds: 7
Polar Surface Area: 89.77Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.35CX Basic pKa: 0.11CX LogP: 4.71CX LogD: 4.67
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.21Np Likeness Score: -1.76

References

1. Wu JW, Yin L, Liu YQ, Zhang H, Xie YF, Wang RL, Zhao GL..  (2019)  Synthesis, biological evaluation and 3D-QSAR studies of 1,2,4-triazole-5-substituted carboxylic acid bioisosteres as uric acid transporter 1 (URAT1) inhibitors for the treatment of hyperuricemia associated with gout.,  29  (3): [PMID:30579795] [10.1016/j.bmcl.2018.12.036]

Source