The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Selaginpulvilin T ID: ALA4554204
PubChem CID: 137628440
Max Phase: Preclinical
Molecular Formula: C36H28O5
Molecular Weight: 540.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COCc1ccc2c(c1C#Cc1ccc(O)cc1)[C@](c1ccc(O)cc1)(c1ccc(OC)cc1)c1cc(O)ccc1-2
Standard InChI: InChI=1S/C36H28O5/c1-40-22-24-6-19-33-32-20-15-29(39)21-34(32)36(25-7-13-28(38)14-8-25,26-9-16-30(41-2)17-10-26)35(33)31(24)18-5-23-3-11-27(37)12-4-23/h3-4,6-17,19-21,37-39H,22H2,1-2H3/t36-/m1/s1
Standard InChI Key: LGIFMJHIMJHUBF-PSXMRANNSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
5.6540 -27.6454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2457 -28.9162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9935 -28.1331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1909 -27.9613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6396 -28.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8965 -29.3566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6986 -29.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3275 -28.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0688 -28.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6159 -29.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4216 -29.3587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6774 -28.5729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1284 -27.9644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8326 -28.4005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0379 -26.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0666 -27.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8663 -26.8802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2500 -26.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8065 -25.4473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9752 -25.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5952 -26.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2846 -26.2551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6979 -25.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8944 -25.8827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6809 -26.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2690 -27.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5303 -27.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9321 -26.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3340 -25.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1573 -25.7936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5591 -25.0740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1360 -24.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3069 -24.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9088 -25.0999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5369 -23.6437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4844 -28.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3103 -25.3001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1879 -24.7158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7392 -27.6166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5461 -27.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7451 -24.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 9 1 0
8 1 1 0
1 3 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
5 14 1 0
1 15 1 1
1 16 1 0
15 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 15 1 0
16 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 16 1 0
13 27 1 0
27 28 3 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
12 36 1 0
24 37 1 0
19 38 1 0
36 39 1 0
39 40 1 0
38 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.62Molecular Weight (Monoisotopic): 540.1937AlogP: 6.72#Rotatable Bonds: 5Polar Surface Area: 79.15Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.23CX Basic pKa: ┄CX LogP: 7.52CX LogD: 7.52Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.21Np Likeness Score: 0.10
References 1. Woo S, Kang KB, Kim J, Sung SH.. (2019) Molecular Networking Reveals the Chemical Diversity of Selaginellin Derivatives, Natural Phosphodiesterase-4 Inhibitors from Selaginella tamariscina., 82 (7): [PMID:31244143 ] [10.1021/acs.jnatprod.9b00049 ]