N-((3-Methyl-5-(1-methyl-1H-pyrazol-5-yl)phenyl)sulfonyl)-2-(naphthalen-2-yloxy)acetamide

ID: ALA4554215

PubChem CID: 155556218

Max Phase: Preclinical

Molecular Formula: C23H21N3O4S

Molecular Weight: 435.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2ccnn2C)cc(S(=O)(=O)NC(=O)COc2ccc3ccccc3c2)c1

Standard InChI:  InChI=1S/C23H21N3O4S/c1-16-11-19(22-9-10-24-26(22)2)14-21(12-16)31(28,29)25-23(27)15-30-20-8-7-17-5-3-4-6-18(17)13-20/h3-14H,15H2,1-2H3,(H,25,27)

Standard InChI Key:  FXQKXQLJXAKGRW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   20.4215   -1.6922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8343   -2.4020    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.2427   -1.6897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7129   -2.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4206   -2.4062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1283   -2.8148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5437   -2.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5387   -3.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2473   -4.0492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9604   -3.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9605   -2.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2513   -2.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0051   -2.4062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2974   -2.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5903   -2.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5953   -4.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2996   -3.6272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8826   -3.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8871   -2.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1839   -2.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4757   -2.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4751   -3.6269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1790   -4.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4206   -1.5890    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2442   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6642   -2.4092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4108   -2.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9575   -2.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5487   -1.4263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7494   -1.5965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1420   -1.0499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  2  1  0
  2  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4 13  1  0
 13 14  1  0
 14 15  2  0
 15 19  1  0
 18 16  1  0
 16 17  2  0
 17 14  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 18  2  0
  5 24  2  0
  9 25  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 26  1  0
 11 26  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4554215

    ---

Associated Targets(Human)

RAPGEF3 Tchem Rap guanine nucleotide exchange factor 3 (15528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.51Molecular Weight (Monoisotopic): 435.1253AlogP: 3.43#Rotatable Bonds: 6
Polar Surface Area: 90.29Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.93CX Basic pKa: 2.10CX LogP: 3.49CX LogD: 2.64
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.50Np Likeness Score: -1.46

References

1. Wang P, Luchowska-Stańska U, van Basten B, Chen H, Liu Z, Wiejak J, Whelan P, Morgan D, Lochhead E, Barker G, Rehmann H, Yarwood SJ, Zhou J..  (2020)  Synthesis and Biochemical Evaluation of Noncyclic Nucleotide Exchange Proteins Directly Activated by cAMP 1 (EPAC1) Regulators.,  63  (10): [PMID:32340447] [10.1021/acs.jmedchem.9b02094]

Source