5'-Isopropoxy-6'-(3-(pyrrolidin-1-yl)propoxy)spiro[cyclopentane-1,3'-indol]-2'-amine

ID: ALA4554293

PubChem CID: 155556616

Max Phase: Preclinical

Molecular Formula: C22H33N3O2

Molecular Weight: 371.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)Oc1cc2c(cc1OCCCN1CCCC1)N=C(N)C21CCCC1

Standard InChI:  InChI=1S/C22H33N3O2/c1-16(2)27-20-14-17-18(24-21(23)22(17)8-3-4-9-22)15-19(20)26-13-7-12-25-10-5-6-11-25/h14-16H,3-13H2,1-2H3,(H2,23,24)

Standard InChI Key:  DBEJHYMPTLNKLS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    8.3280  -15.9317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0439  -15.5182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7560  -15.9312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7560  -16.7550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0423  -17.1679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3280  -16.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6120  -17.1743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8961  -16.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1801  -17.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4641  -16.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7481  -17.1743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6625  -17.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8566  -18.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4429  -17.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9975  -16.8370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5428  -17.0106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0269  -16.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5428  -15.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0228  -15.0356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4724  -14.3397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2680  -14.5528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2680  -15.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8506  -16.3411    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6120  -15.5177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6120  -14.6899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8961  -14.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3280  -14.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 12 11  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
  4 16  1  0
 17 16  2  0
 18 17  1  0
  3 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 18 22  1  0
 17 23  1  0
  1 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4554293

    ---

Associated Targets(Human)

EHMT2 Tchem Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 (93046 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SPIN1 Tchem Spindlin-1 (66 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 371.53Molecular Weight (Monoisotopic): 371.2573AlogP: 4.15#Rotatable Bonds: 7
Polar Surface Area: 60.08Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.31CX LogP: 3.42CX LogD: 0.55
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.73Np Likeness Score: -0.48

References

1. Fagan V, Johansson C, Gileadi C, Monteiro O, Dunford JE, Nibhani R, Philpott M, Malzahn J, Wells G, Faram R, Cribbs AP, Halidi N, Li F, Chau I, Greschik H, Velupillai S, Allali-Hassani A, Bennett J, Christott T, Giroud C, Lewis AM, Huber KVM, Athanasou N, Bountra C, Jung M, Schüle R, Vedadi M, Arrowsmith C, Xiong Y, Jin J, Fedorov O, Farnie G, Brennan PE, Oppermann U..  (2019)  A Chemical Probe for Tudor Domain Protein Spindlin1 to Investigate Chromatin Function.,  62  (20): [PMID:31550156] [10.1021/acs.jmedchem.9b00562]

Source