(4Z,7Z,10Z,13Z,16Z,19Z)-N-(Tetrahydro-2H-pyran-4-yl)docosa-4,7,10,13,16,19-hexaenamide

ID: ALA4554330

PubChem CID: 155556177

Max Phase: Preclinical

Molecular Formula: C27H41NO2

Molecular Weight: 411.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NC1CCOCC1

Standard InChI:  InChI=1S/C27H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-27(29)28-26-22-24-30-25-23-26/h3-4,6-7,9-10,12-13,15-16,18-19,26H,2,5,8,11,14,17,20-25H2,1H3,(H,28,29)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-

Standard InChI Key:  NPLCTIRRQQRCRP-KUBAVDMBSA-N

Molfile:  

 
     RDKit          2D

 30 30  0  0  0  0  0  0  0  0999 V2000
   15.0107   -3.7723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7226   -3.3596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4303   -3.7723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1421   -3.3596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2989   -3.3596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0107   -4.5936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8506   -3.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8521   -4.5840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5605   -4.9913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5620   -5.8085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8551   -6.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8566   -7.0356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1496   -7.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4412   -7.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7342   -7.4481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0257   -7.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0242   -6.2236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3158   -5.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6088   -6.2262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6103   -7.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9034   -7.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9017   -8.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6086   -8.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3171   -8.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5904   -3.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8844   -3.3507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1781   -3.7545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1723   -4.5720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8791   -4.9841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5917   -4.5786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  1  5  1  0
  1  6  2  0
  4  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
  5 25  1  0
 25 26  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4554330

    ---

Associated Targets(non-human)

RBL-2H3 (1162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.63Molecular Weight (Monoisotopic): 411.3137AlogP: 6.76#Rotatable Bonds: 15
Polar Surface Area: 38.33Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.13CX LogD: 6.13
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.30Np Likeness Score: 0.33

References

1. Kim IH, Kanayama Y, Nishiwaki H, Sugahara T, Nishi K..  (2019)  Structure-Activity Relationships of Fish Oil Derivatives with Antiallergic Activity in Vitro and in Vivo.,  62  (21): [PMID:31618024] [10.1021/acs.jmedchem.9b00994]

Source