Methyl-(S)-3-(4-(benzyloxy)phenyl)-2-(2-(1-(3,3-diphenylpropanoyl)piperidin-4-yl)acetamido)propanoate

ID: ALA4554365

PubChem CID: 134355768

Max Phase: Preclinical

Molecular Formula: C39H42N2O5

Molecular Weight: 618.77

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)CC1CCN(C(=O)CC(c2ccccc2)c2ccccc2)CC1

Standard InChI:  InChI=1S/C39H42N2O5/c1-45-39(44)36(25-29-17-19-34(20-18-29)46-28-31-11-5-2-6-12-31)40-37(42)26-30-21-23-41(24-22-30)38(43)27-35(32-13-7-3-8-14-32)33-15-9-4-10-16-33/h2-20,30,35-36H,21-28H2,1H3,(H,40,42)/t36-/m0/s1

Standard InChI Key:  XQUIHRMCAROKEX-BHVANESWSA-N

Molfile:  

 
     RDKit          2D

 46 50  0  0  0  0  0  0  0  0999 V2000
   18.5287   -9.3876    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2422   -8.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9599   -9.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9599  -10.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2422  -10.6283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5287  -10.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6732  -10.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3864  -10.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3864   -9.3880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.0996  -10.6281    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8170  -10.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5302  -10.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2435  -10.2134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9608  -10.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5302  -11.4536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8170   -9.3880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5302   -8.9773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2439   -9.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9560   -8.9807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9592   -8.1557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2415   -7.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5247   -8.1548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6725   -7.7408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3857   -8.1557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0990   -7.7408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8167   -8.1559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5246   -7.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5280   -6.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8143   -6.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0974   -6.9183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8155   -8.9769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8155   -8.1515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0981   -9.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3849   -8.9769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6716   -9.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9581   -8.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2460   -9.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2427  -10.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9563  -10.6243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6732  -10.2101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3849   -8.1530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0987   -7.7429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0991   -6.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3850   -6.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6692   -6.9234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6724   -7.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  2  0
 11 16  1  1
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 17 22  1  0
 20 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 25 30  1  0
  1 31  1  0
 31 32  2  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 35 40  1  0
 34 41  1  0
 41 42  2  0
 42 43  1  0
 43 44  2  0
 44 45  1  0
 45 46  2  0
 46 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4554365

    ---

Associated Targets(Human)

NCI-H1650 (1118 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
YAP1 Tchem Transcriptional coactivator YAP1 (194 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 618.77Molecular Weight (Monoisotopic): 618.3094AlogP: 6.32#Rotatable Bonds: 13
Polar Surface Area: 84.94Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.19CX Basic pKa: CX LogP: 6.21CX LogD: 6.21
Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.18Np Likeness Score: -0.61

References

1.  (2018)  Yap1 inhibitors that target the interaction of yap1 with oct4, 

Source