The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-((5-chloro-4-((2-(isopropylsulfonyl)phenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-3-(2-oxo-2-thiomorpholinoethyl)imidazolidin-2-one ID: ALA4554368
PubChem CID: 155556505
Max Phase: Preclinical
Molecular Formula: C29H34ClN7O5S2
Molecular Weight: 660.22
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCN(CC(=O)N3CCSCC3)C2=O)ccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1
Standard InChI: InChI=1S/C29H34ClN7O5S2/c1-19(2)44(40,41)25-7-5-4-6-23(25)32-27-21(30)17-31-28(34-27)33-22-9-8-20(16-24(22)42-3)37-11-10-36(29(37)39)18-26(38)35-12-14-43-15-13-35/h4-9,16-17,19H,10-15,18H2,1-3H3,(H2,31,32,33,34)
Standard InChI Key: CNJHUOPURJMIPZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
29.5221 -6.0423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7049 -6.0423 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.1135 -6.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0018 -3.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0007 -4.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7087 -5.2277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4184 -4.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4156 -3.9956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7069 -3.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1267 -5.2258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8338 -4.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0007 -6.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0005 -7.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2931 -6.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5388 -5.2240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2454 -4.8150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2446 -3.9969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5312 -3.5896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8276 -4.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1172 -3.5970 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
32.9536 -5.2228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6608 -4.8134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3680 -5.2229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0748 -4.8142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0743 -3.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3612 -3.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6573 -3.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3678 -6.0401 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0753 -6.4489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7791 -2.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7848 -3.5835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5615 -3.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0359 -3.1673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5523 -2.5115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1146 -2.2929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7994 -1.7326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5975 -1.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8446 -0.7782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1485 -2.1606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8994 -2.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4466 -3.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2459 -3.3682 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.4952 -2.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9451 -1.9812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 2 1 0
7 10 1 0
10 11 1 0
2 12 1 0
12 13 1 0
12 14 1 0
11 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 11 1 0
19 20 1 0
16 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
23 28 1 0
28 29 1 0
25 31 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 30 1 0
30 35 2 0
34 36 1 0
36 37 1 0
37 38 2 0
37 39 1 0
39 40 1 0
39 44 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 660.22Molecular Weight (Monoisotopic): 659.1751AlogP: 4.63#Rotatable Bonds: 10Polar Surface Area: 137.07Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.55CX Basic pKa: 3.15CX LogP: 3.09CX LogD: 3.09Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.32Np Likeness Score: -2.00
References 1. Lei H, Jiang N, Miao X, Xing L, Guo M, Liu Y, Xu H, Gong P, Zuo D, Zhai X.. (2019) Discovery of novel mutant-combating ALK and ROS1 dual inhibitors bearing imidazolidin-2-one moiety with reasonable PK properties., 171 [PMID:30927566 ] [10.1016/j.ejmech.2019.03.038 ]