The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(4-Methoxybenzylidene)-2,4-dioxothiazolidin-3-yl)-N-(4-methoxyphenyl)acetamide ID: ALA4554477
PubChem CID: 16632104
Max Phase: Preclinical
Molecular Formula: C20H18N2O5S
Molecular Weight: 398.44
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(OC)cc3)C2=O)cc1
Standard InChI: InChI=1S/C20H18N2O5S/c1-26-15-7-3-13(4-8-15)11-17-19(24)22(20(25)28-17)12-18(23)21-14-5-9-16(27-2)10-6-14/h3-11H,12H2,1-2H3,(H,21,23)/b17-11-
Standard InChI Key: VYTSSXJUZNXNQC-BOPFTXTBSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
4.6884 -22.8086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5097 -22.8086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7682 -22.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1011 -21.5415 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.4382 -22.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6568 -21.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4865 -20.9722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0996 -20.4219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9257 -19.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1436 -19.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5351 -19.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7080 -20.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5457 -21.7763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9934 -23.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8103 -23.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2899 -24.0558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1068 -23.9672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5863 -24.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4025 -24.5496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7365 -23.7987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2524 -23.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4379 -23.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1436 -22.6397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2072 -23.4732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5493 -23.7136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0294 -24.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9716 -18.5674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5775 -18.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 13 2 0
2 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
15 23 2 0
1 24 2 0
20 25 1 0
25 26 1 0
10 27 1 0
27 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.44Molecular Weight (Monoisotopic): 398.0936AlogP: 3.38#Rotatable Bonds: 6Polar Surface Area: 84.94Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.16CX Basic pKa: ┄CX LogP: 2.67CX LogD: 2.67Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.75Np Likeness Score: -1.67
References 1. Hassan GS, Georgey HH, Mohammed EZ, Omar FA.. (2019) Anti-hepatitis-C virus activity and QSAR study of certain thiazolidinone and thiazolotriazine derivatives as potential NS5B polymerase inhibitors., 184 [PMID:31604164 ] [10.1016/j.ejmech.2019.111747 ]