3,5-diamino-N-carbamimidoyl-6-(5-chlorobenzofuran-2-yl)pyrazine-2-carboxamide

ID: ALA4554541

PubChem CID: 155556228

Max Phase: Preclinical

Molecular Formula: C14H12ClN7O2

Molecular Weight: 345.75

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N=C(N)NC(=O)c1nc(-c2cc3cc(Cl)ccc3o2)c(N)nc1N

Standard InChI:  InChI=1S/C14H12ClN7O2/c15-6-1-2-7-5(3-6)4-8(24-7)9-11(16)21-12(17)10(20-9)13(23)22-14(18)19/h1-4H,(H4,16,17,21)(H4,18,19,22,23)

Standard InChI Key:  XXUHULBINIOYER-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    6.5815   -4.8164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5804   -5.6360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2884   -6.0449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9981   -5.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9952   -4.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2866   -4.4076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7064   -6.0430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8723   -6.0440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7014   -4.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4106   -4.8075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6983   -3.5844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1168   -4.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8261   -4.8022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1137   -3.5791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8758   -4.4082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7908   -3.5958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1302   -4.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5851   -4.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9942   -3.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5899   -2.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7766   -2.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3693   -3.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7760   -4.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5521   -3.4320    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  2  8  1  0
  5  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 12 13  1  0
 12 14  2  0
  1 15  1  0
 15 16  1  0
 16 19  1  0
 18 17  1  0
 17 15  2  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 22 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4554541

    ---

Associated Targets(Human)

PLAU Tchem Urokinase-type plasminogen activator (2016 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 345.75Molecular Weight (Monoisotopic): 345.0741AlogP: 1.33#Rotatable Bonds: 2
Polar Surface Area: 169.93Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 8#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.77CX Basic pKa: 6.11CX LogP: 1.40CX LogD: 1.37
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.34Np Likeness Score: -0.39

References

1. Buckley BJ, Majed H, Aboelela A, Minaei E, Jiang L, Fildes K, Cheung CY, Johnson D, Bachovchin D, Cook GM, Huang M, Ranson M, Kelso MJ..  (2019)  6-Substituted amiloride derivatives as inhibitors of the urokinase-type plasminogen activator for use in metastatic disease.,  29  (24): [PMID:31679971] [10.1016/j.bmcl.2019.126753]

Source