4-Bromo-N-[3-[3-(3,4-dichlorophenyl)ureido]propyl]benzenesulfonamide

ID: ALA4554559

PubChem CID: 89717871

Max Phase: Preclinical

Molecular Formula: C16H16BrCl2N3O3S

Molecular Weight: 481.20

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCCCNS(=O)(=O)c1ccc(Br)cc1)Nc1ccc(Cl)c(Cl)c1

Standard InChI:  InChI=1S/C16H16BrCl2N3O3S/c17-11-2-5-13(6-3-11)26(24,25)21-9-1-8-20-16(23)22-12-4-7-14(18)15(19)10-12/h2-7,10,21H,1,8-9H2,(H2,20,22,23)

Standard InChI Key:  KIDAGDXZUOIHQR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 27  0  0  0  0  0  0  0  0999 V2000
   39.8855  -29.3033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4811  -28.5976    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   39.0721  -29.3007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7724  -28.1951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1878  -28.1897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.8970  -28.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6032  -28.1844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7706  -27.3809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0628  -26.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3589  -27.3910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3673  -28.2102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0757  -28.6089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6478  -26.9884    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   42.3125  -28.5903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0186  -28.1791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.7279  -28.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4340  -28.1737    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.7309  -29.4022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.1433  -28.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1439  -29.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8524  -29.8010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.5595  -29.3897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.5538  -28.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8448  -28.1662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.2585  -28.1546    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   47.2693  -29.7947    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  2  1  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  4  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  4  1  0
 10 13  1  0
  7 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 23 25  1  0
 22 26  1  0
M  END

Associated Targets(Human)

SRR Tbio Serine racemase (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 481.20Molecular Weight (Monoisotopic): 478.9473AlogP: 4.25#Rotatable Bonds: 7
Polar Surface Area: 87.30Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.62CX Basic pKa: CX LogP: 3.77CX LogD: 3.77
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.52Np Likeness Score: -2.10

References

1.  (2014)  Serine racemase inhibitor, 

Source