The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-((5-chloro-4-((2-(isopropylsulfonyl)phenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-3-(2-oxo-2-(pyrrolidin-1-yl)ethyl)imidazolidin-2-one ID: ALA4554640
PubChem CID: 155556146
Max Phase: Preclinical
Molecular Formula: C29H34ClN7O5S
Molecular Weight: 628.15
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCN(CC(=O)N3CCCC3)C2=O)ccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1
Standard InChI: InChI=1S/C29H34ClN7O5S/c1-19(2)43(40,41)25-9-5-4-8-23(25)32-27-21(30)17-31-28(34-27)33-22-11-10-20(16-24(22)42-3)37-15-14-36(29(37)39)18-26(38)35-12-6-7-13-35/h4-5,8-11,16-17,19H,6-7,12-15,18H2,1-3H3,(H2,31,32,33,34)
Standard InChI Key: ZEDPELSGUGCUAU-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
2.8932 -30.3847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0760 -30.3847 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.4846 -31.0924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3729 -28.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3718 -29.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0798 -29.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7895 -29.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7867 -28.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0781 -27.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4979 -29.5682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2049 -29.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3718 -30.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3716 -31.6129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6642 -30.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9099 -29.5664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6165 -29.1574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6157 -28.3393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9024 -27.9320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1987 -28.3434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4883 -27.9394 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.3247 -29.5652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0319 -29.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7391 -29.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4459 -29.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4455 -28.3386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7323 -27.9309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0285 -28.3419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7389 -30.3825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4465 -30.7913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1502 -27.1111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1559 -27.9259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9326 -28.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4070 -27.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9234 -26.8539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4858 -26.6353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1705 -26.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9686 -25.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2157 -25.1206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5196 -26.5030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3577 -27.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0682 -27.7069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6717 -27.1559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3340 -26.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 2 1 0
7 10 1 0
10 11 1 0
2 12 1 0
12 13 1 0
12 14 1 0
11 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 11 1 0
19 20 1 0
16 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
23 28 1 0
28 29 1 0
25 31 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 30 1 0
30 35 2 0
34 36 1 0
36 37 1 0
37 38 2 0
37 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 628.15Molecular Weight (Monoisotopic): 627.2031AlogP: 4.67#Rotatable Bonds: 10Polar Surface Area: 137.07Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.55CX Basic pKa: 3.15CX LogP: 3.14CX LogD: 3.14Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.33Np Likeness Score: -1.87
References 1. Lei H, Jiang N, Miao X, Xing L, Guo M, Liu Y, Xu H, Gong P, Zuo D, Zhai X.. (2019) Discovery of novel mutant-combating ALK and ROS1 dual inhibitors bearing imidazolidin-2-one moiety with reasonable PK properties., 171 [PMID:30927566 ] [10.1016/j.ejmech.2019.03.038 ]