The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-4-(4-oxo-5-(3,4,5-trimethoxybenzylidene)-4,5-dihydrothiazol-2-ylamino)phenyl sulfamate ID: ALA4554643
PubChem CID: 155556147
Max Phase: Preclinical
Molecular Formula: C19H19N3O7S2
Molecular Weight: 465.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C2/SC(Nc3ccc(OS(N)(=O)=O)cc3)=NC2=O)cc(OC)c1OC
Standard InChI: InChI=1S/C19H19N3O7S2/c1-26-14-8-11(9-15(27-2)17(14)28-3)10-16-18(23)22-19(30-16)21-12-4-6-13(7-5-12)29-31(20,24)25/h4-10H,1-3H3,(H2,20,24,25)(H,21,22,23)/b16-10+
Standard InChI Key: WWOUYKDYLNVBGB-MHWRWJLKSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
26.0304 -16.9010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2132 -16.9010 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.6218 -17.6087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8044 -18.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8033 -19.3590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5113 -19.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2210 -19.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2182 -18.5359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5095 -18.1306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5111 -20.5852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5071 -17.3134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2112 -16.0855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2187 -20.9939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3069 -21.8048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1062 -21.9749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5150 -21.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9683 -20.6599 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.4384 -22.7215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3277 -21.1819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8080 -21.8431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4744 -22.5883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9539 -23.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7676 -23.1642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0994 -22.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6179 -21.7551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2487 -23.8247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9118 -22.3246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3944 -22.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6211 -23.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8083 -24.0803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9172 -24.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 10 1 0
9 11 1 0
11 2 1 0
2 12 1 0
10 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
15 18 2 0
16 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
24 27 1 0
27 28 1 0
22 29 1 0
29 30 1 0
26 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.51Molecular Weight (Monoisotopic): 465.0664AlogP: 2.38#Rotatable Bonds: 7Polar Surface Area: 138.54Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.85CX Basic pKa: ┄CX LogP: 1.82CX LogD: 1.82Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.59Np Likeness Score: -0.99
References 1. Zaraei SO, Abduelkarem AR, Anbar HS, Kobeissi S, Mohammad M, Ossama A, El-Gamal MI.. (2019) Sulfamates in drug design and discovery: Pre-clinical and clinical investigations., 179 [PMID:31255926 ] [10.1016/j.ejmech.2019.06.052 ]