Methyl N-[(10R,14S)-14-[1-(3-Chlorophenyl)-1H-pyrazole-4-amido]-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.0(2,7)]nonadeca-1(19),2(7),3,5,15,17-hexaen-5-yl]carbamate

ID: ALA4554665

PubChem CID: 71509332

Max Phase: Preclinical

Molecular Formula: C30H29ClN6O4

Molecular Weight: 573.05

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  COC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)CCC[C@H](NC(=O)c1cnn(-c3cccc(Cl)c3)c1)c1cc-2ccn1

Standard InChI:  InChI=1S/C30H29ClN6O4/c1-18-5-3-8-25(35-29(39)20-16-33-37(17-20)23-7-4-6-21(31)14-23)27-13-19(11-12-32-27)24-10-9-22(34-30(40)41-2)15-26(24)36-28(18)38/h4,6-7,9-18,25H,3,5,8H2,1-2H3,(H,34,40)(H,35,39)(H,36,38)/t18-,25+/m1/s1

Standard InChI Key:  GIJJNSLCZDMWMU-CJAUYULYSA-N

Molfile:  

 
     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   32.4772   -2.9468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1890   -2.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4772   -3.7682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1890   -1.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9008   -1.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6127   -1.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3245   -1.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.6127   -2.5341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3245   -2.9468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3222   -3.7692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0332   -4.1777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7419   -3.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7393   -2.9435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0318   -2.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6133   -4.1786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9019   -3.7671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1898   -4.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1881   -4.9961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9042   -5.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6133   -4.9965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7661   -4.1780    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0576   -3.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3465   -4.1805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0562   -2.9494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9008   -0.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4496   -2.5283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.1629   -2.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1658   -3.7599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.8733   -2.5233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5866   -2.9336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5985   -3.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0488   -4.4610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4587   -5.1721    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2616   -5.0019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1257   -5.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3117   -6.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9788   -6.7462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4589   -7.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2756   -7.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6047   -6.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7578   -7.9804    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  1  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 10 15  1  0
 17  3  1  0
  3 21  1  1
 21 22  1  0
 22 23  1  0
 22 24  2  0
  5 25  1  1
 13 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  1  0
 23 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  1  0
 34 23  2  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 35  1  0
 33 35  1  0
 39 41  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4554665

   US10208068, Example 5

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 573.05

Molecular Weight (Monoisotopic): 572.1939

AlogP: 6.00

#Rotatable Bonds: 4

Polar Surface Area: 127.24

Molecular Species: NEUTRAL

HBA: 7

HBD: 3

#RO5 Violations: 2

HBA (Lipinski): 10

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 12.49

CX Basic pKa: 3.76

CX LogP: 4.94

CX LogD: 4.94

Aromatic Rings: 4

Heavy Atoms: 41

QED Weighted: 0.28

Np Likeness Score: -1.35

References

1. Corte JR, Pinto DJP, Fang T, Osuna H, Yang W, Wang Y, Lai A, Clark CG, Sun JH, Rampulla R, Mathur A, Kaspady M, Neithnadka PR, Li YC, Rossi KA, Myers JE, Sheriff S, Lou Z, Harper TW, Huang C, Zheng JJ, Bozarth JM, Wu Y, Wong PC, Crain EJ, Seiffert DA, Luettgen JM, Lam PYS, Wexler RR, Ewing WR..  (2020)  Potent, Orally Bioavailable, and Efficacious Macrocyclic Inhibitors of Factor XIa. Discovery of Pyridine-Based Macrocycles Possessing Phenylazole Carboxamide P1 Groups.,  63  (2): [PMID:31833761] [10.1021/acs.jmedchem.9b01768]

Source

Source(1):

• Scientific Literature