(2-(4-Amino-6-((4-phenoxyphenethyl)amino)-1,3,5-triazin-2-yl)-4-chlorophenyl)methanol

ID: ALA4554735

PubChem CID: 155556045

Max Phase: Preclinical

Molecular Formula: C24H22ClN5O2

Molecular Weight: 447.93

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1nc(NCCc2ccc(Oc3ccccc3)cc2)nc(-c2cc(Cl)ccc2CO)n1

Standard InChI:  InChI=1S/C24H22ClN5O2/c25-18-9-8-17(15-31)21(14-18)22-28-23(26)30-24(29-22)27-13-12-16-6-10-20(11-7-16)32-19-4-2-1-3-5-19/h1-11,14,31H,12-13,15H2,(H3,26,27,28,29,30)

Standard InChI Key:  ZRMZSTOHCICDQU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   32.4262  -11.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4251  -12.6481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1331  -13.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8428  -12.6477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8399  -11.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1313  -11.4197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5431  -11.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2526  -11.8227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9583  -11.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9557  -10.5940    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2414  -10.1883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5387  -10.6012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6673  -11.8184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.3737  -11.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2355   -9.3711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.1289  -10.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4200  -10.1961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.0828  -11.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1329  -13.8743    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   38.7891  -11.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4941  -11.8115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2000  -11.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1977  -10.5832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4837  -10.1772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7807  -10.5897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9035  -10.1714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.6131  -10.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6117  -11.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3205  -11.7975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0273  -11.3856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0209  -10.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3115  -10.1626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  5  7  1  0
  9 13  1  0
 13 14  1  0
 11 15  1  0
  6 16  1  0
 16 17  1  0
 14 18  1  0
  3 19  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4554735

    ---

Associated Targets(Human)

GPR68 Tchem Ovarian cancer G-protein coupled receptor 1 (279 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.93Molecular Weight (Monoisotopic): 447.1462AlogP: 4.71#Rotatable Bonds: 8
Polar Surface Area: 106.18Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.42CX LogP: 5.44CX LogD: 5.40
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -0.84

References

1. Yu X, Huang XP, Kenakin TP, Slocum ST, Chen X, Martini ML, Liu J, Jin J..  (2019)  Design, Synthesis, and Characterization of Ogerin-Based Positive Allosteric Modulators for G Protein-Coupled Receptor 68 (GPR68).,  62  (16): [PMID:31298539] [10.1021/acs.jmedchem.9b00869]

Source